Compare commits
59 Commits
v1.0.0-alp
...
dependabot
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
d5911212a4 | ||
|
|
b13505c1c3 | ||
|
|
0adff9c35f | ||
|
|
908b0f9f5e | ||
|
|
169385bb5b | ||
|
|
f741122ffb | ||
|
|
959b4f8172 | ||
|
|
55b680c194 | ||
|
|
43aed386bc | ||
|
|
cb713e5b8c | ||
|
|
2c4e90a76f | ||
|
|
18bd329617 | ||
|
|
9e681b39fb | ||
|
|
6817ca9bcb | ||
|
|
73862be3ba | ||
|
|
02fa340896 | ||
|
|
4ee41dbc40 | ||
|
|
278210bb89 | ||
|
|
6fb45d8a73 | ||
|
|
e803ee9010 | ||
|
|
82632897aa | ||
|
|
46d39beb2c | ||
|
|
00ec19ef2d | ||
|
|
77f9977c02 | ||
|
|
9e7d99e3bf | ||
|
|
cc552c5f91 | ||
|
|
27a63abd1e | ||
|
|
bc8d6a396b | ||
|
|
f1b112e8f9 | ||
|
|
9a250baf62 | ||
|
|
79b84bed0e | ||
|
|
06a956ad20 | ||
|
|
c3265e2514 | ||
|
|
96f1d94e2c | ||
|
|
1886dc4fe7 | ||
|
|
24994a3ed4 | ||
|
|
d294e2e318 | ||
|
|
7c6cbc4d9f | ||
|
|
6cf3963c6c | ||
|
|
7d5f31f6cc | ||
|
|
5998a22819 | ||
|
|
d6a0cf0795 | ||
|
|
6e27e66738 | ||
|
|
f382fa9230 | ||
|
|
e71770f93e | ||
|
|
298f6cb1e8 | ||
|
|
3fdab87ee7 | ||
|
|
855c61a6ab | ||
|
|
0112c67b60 | ||
|
|
1010efd8d6 | ||
|
|
991cb77b6f | ||
|
|
e553231eae | ||
|
|
0a7b60f0f7 | ||
|
|
0ecc0280c0 | ||
|
|
afbf83c8b0 | ||
|
|
2f2f138595 | ||
|
|
95250fc44e | ||
|
|
f17df1e133 | ||
|
|
3569acca0b |
8
.github/dependabot.yml
vendored
Normal file
8
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,8 @@
|
||||
# Set update schedule for GitHub Actions
|
||||
version: 2
|
||||
updates:
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
# Check for updates to GitHub Actions every week
|
||||
interval: "weekly"
|
||||
3
.github/workflows/code_coverage.yml
vendored
3
.github/workflows/code_coverage.yml
vendored
@@ -27,6 +27,7 @@ jobs:
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Install grcov
|
||||
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||
# TODO: re-enable the hwi tests
|
||||
- name: Build simulator image
|
||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||
- name: Run simulator image
|
||||
@@ -50,7 +51,7 @@ jobs:
|
||||
with:
|
||||
github-token: ${{ secrets.GITHUB_TOKEN }}
|
||||
- name: Upload artifact
|
||||
uses: actions/upload-artifact@v2
|
||||
uses: actions/upload-artifact@v4
|
||||
with:
|
||||
name: coverage-report
|
||||
path: coverage-report.html
|
||||
|
||||
23
.github/workflows/cont_integration.yml
vendored
23
.github/workflows/cont_integration.yml
vendored
@@ -12,7 +12,7 @@ jobs:
|
||||
rust:
|
||||
- version: stable
|
||||
clippy: true
|
||||
- version: 1.57.0 # MSRV
|
||||
- version: 1.63.0 # MSRV
|
||||
features:
|
||||
- --no-default-features
|
||||
- --all-features
|
||||
@@ -28,25 +28,12 @@ jobs:
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Pin dependencies for MSRV
|
||||
if: matrix.rust.version == '1.57.0'
|
||||
if: matrix.rust.version == '1.63.0'
|
||||
run: |
|
||||
cargo update -p log --precise "0.4.18"
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
cargo update -p tokio:1.33.0 --precise "1.29.1"
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||
cargo update -p zip:0.6.6 --precise "0.6.2"
|
||||
cargo update -p time --precise "0.3.13"
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
cargo update -p zip --precise "0.6.2"
|
||||
cargo update -p time --precise "0.3.20"
|
||||
cargo update -p jobserver --precise "0.1.26"
|
||||
cargo update -p reqwest --precise "0.11.19"
|
||||
- name: Build
|
||||
run: cargo build ${{ matrix.features }}
|
||||
- name: Test
|
||||
|
||||
2
.github/workflows/nightly_docs.yml
vendored
2
.github/workflows/nightly_docs.yml
vendored
@@ -22,7 +22,7 @@ jobs:
|
||||
env:
|
||||
RUSTDOCFLAGS: '--cfg docsrs -Dwarnings'
|
||||
- name: Upload artifact
|
||||
uses: actions/upload-artifact@v2
|
||||
uses: actions/upload-artifact@v4
|
||||
with:
|
||||
name: built-docs
|
||||
path: ./target/doc/*
|
||||
|
||||
@@ -517,7 +517,7 @@ final transaction is created by calling `finish` on the builder.
|
||||
- Default to SIGHASH_ALL if not specified
|
||||
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
||||
- Make 'unspendable' into a HashSet
|
||||
- Stop implicitly enforcing manaul selection by .add_utxo
|
||||
- Stop implicitly enforcing manual selection by .add_utxo
|
||||
- Rename DumbCS to LargestFirstCoinSelection
|
||||
- Rename must_use_utxos to required_utxos
|
||||
- Rename may_use_utxos to optional_uxtos
|
||||
|
||||
44
README.md
44
README.md
@@ -15,7 +15,7 @@
|
||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
||||
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||
</p>
|
||||
|
||||
@@ -60,45 +60,19 @@ Fully working examples of how to use these components are in `/example-crates`:
|
||||
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||
|
||||
## Minimum Supported Rust Version (MSRV)
|
||||
This library should compile with any combination of features with Rust 1.57.0.
|
||||
This library should compile with any combination of features with Rust 1.63.0.
|
||||
|
||||
To build with the MSRV you will need to pin dependencies as follows:
|
||||
|
||||
```shell
|
||||
# log 0.4.19 has MSRV 1.60.0+
|
||||
cargo update -p log --precise "0.4.18"
|
||||
# tempfile 3.7.0 has MSRV 1.63.0+
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
# rustls 0.21.7 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||
# rustls 0.20.9 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
# tokio 1.33 has MSRV 1.63.0+
|
||||
cargo update -p tokio:1.33.0 --precise "1.29.1"
|
||||
# tokio-util 0.7.9 doesn't build with MSRV 1.57.0
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
# flate2 1.0.27 has MSRV 1.63.0+
|
||||
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||
# reqwest 0.11.19 has MSRV 1.63.0+
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
# h2 0.3.21 has MSRV 1.63.0+
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
# rustls-webpki 0.100.3 has MSRV 1.60.0+
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
# rustls-webpki 0.101.2 has MSRV 1.60.0+
|
||||
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||
# zip 0.6.6 has MSRV 1.59.0+
|
||||
cargo update -p zip:0.6.6 --precise "0.6.2"
|
||||
# time 0.3.14 has MSRV 1.59.0+
|
||||
cargo update -p time --precise "0.3.13"
|
||||
# cc 1.0.82 has MSRV 1.61.0+
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
# byteorder 1.5.0 has MSRV 1.60.0+
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
# webpki 0.22.4 requires `ring:0.17.2` which has MSRV 1.61.0+
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
# jobserver 0.1.27 has MSRV 1.66.0+
|
||||
# zip 0.6.3 has MSRV 1.64.0+
|
||||
cargo update -p zip --precise "0.6.2"
|
||||
# time 0.3.21 has MSRV 1.65.0+
|
||||
cargo update -p time --precise "0.3.20"
|
||||
# jobserver 0.1.27 has MSRV 1.66.0
|
||||
cargo update -p jobserver --precise "0.1.26"
|
||||
# reqwest 0.11.20 has MSRV > 1.63.0+
|
||||
cargo update -p reqwest --precise "0.11.19"
|
||||
```
|
||||
|
||||
## License
|
||||
|
||||
@@ -10,10 +10,9 @@ readme = "README.md"
|
||||
license = "MIT OR Apache-2.0"
|
||||
authors = ["Bitcoin Dev Kit Developers"]
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
rust-version = "1.63"
|
||||
|
||||
[dependencies]
|
||||
log = "0.4"
|
||||
rand = "^0.8"
|
||||
miniscript = { version = "10.0.0", features = ["serde"], default-features = false }
|
||||
bitcoin = { version = "0.30.0", features = ["serde", "base64", "rand-std"], default-features = false }
|
||||
@@ -45,8 +44,10 @@ dev-getrandom-wasm = ["getrandom/js"]
|
||||
|
||||
[dev-dependencies]
|
||||
lazy_static = "1.4"
|
||||
env_logger = "0.7"
|
||||
assert_matches = "1.5.0"
|
||||
tempfile = "3"
|
||||
bdk_file_store = { path = "../file_store" }
|
||||
anyhow = "1"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
|
||||
@@ -13,7 +13,7 @@
|
||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
||||
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||
</p>
|
||||
|
||||
|
||||
@@ -11,15 +11,12 @@
|
||||
|
||||
extern crate bdk;
|
||||
extern crate bitcoin;
|
||||
extern crate log;
|
||||
extern crate miniscript;
|
||||
extern crate serde_json;
|
||||
|
||||
use std::error::Error;
|
||||
use std::str::FromStr;
|
||||
|
||||
use log::info;
|
||||
|
||||
use bitcoin::Network;
|
||||
use miniscript::policy::Concrete;
|
||||
use miniscript::Descriptor;
|
||||
@@ -36,13 +33,9 @@ use bdk::{KeychainKind, Wallet};
|
||||
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
env_logger::init_from_env(
|
||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||
);
|
||||
|
||||
// We start with a generic miniscript policy string
|
||||
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
||||
info!("Compiling policy: \n{}", policy_str);
|
||||
println!("Compiling policy: \n{}", policy_str);
|
||||
|
||||
// Parse the string as a [`Concrete`] type miniscript policy.
|
||||
let policy = Concrete::<String>::from_str(policy_str)?;
|
||||
@@ -51,12 +44,12 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// `policy.compile()` returns the resulting miniscript from the policy.
|
||||
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
||||
|
||||
info!("Compiled into following Descriptor: \n{}", descriptor);
|
||||
println!("Compiled into following Descriptor: \n{}", descriptor);
|
||||
|
||||
// Create a new wallet from this descriptor
|
||||
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
||||
|
||||
info!(
|
||||
println!(
|
||||
"First derived address from the descriptor: \n{}",
|
||||
wallet.get_address(New)
|
||||
);
|
||||
@@ -64,7 +57,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||
// human readable json format.
|
||||
let spending_policy = wallet.policies(KeychainKind::External)?;
|
||||
info!(
|
||||
println!(
|
||||
"The BDK spending policy: \n{}",
|
||||
serde_json::to_string_pretty(&spending_policy)?
|
||||
);
|
||||
|
||||
@@ -6,6 +6,7 @@
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use anyhow::anyhow;
|
||||
use bdk::bitcoin::bip32::DerivationPath;
|
||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||
use bdk::bitcoin::Network;
|
||||
@@ -14,13 +15,11 @@ use bdk::descriptor::IntoWalletDescriptor;
|
||||
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||
use bdk::keys::{GeneratableKey, GeneratedKey};
|
||||
use bdk::miniscript::Tap;
|
||||
use bdk::Error as BDK_Error;
|
||||
use std::error::Error;
|
||||
use std::str::FromStr;
|
||||
|
||||
/// This example demonstrates how to generate a mnemonic phrase
|
||||
/// using BDK and use that to generate a descriptor string.
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let secp = Secp256k1::new();
|
||||
|
||||
// In this example we are generating a 12 words mnemonic phrase
|
||||
@@ -28,7 +27,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// using their respective `WordCount` variant.
|
||||
let mnemonic: GeneratedKey<_, Tap> =
|
||||
Mnemonic::generate((WordCount::Words12, Language::English))
|
||||
.map_err(|_| BDK_Error::Generic("Mnemonic generation error".to_string()))?;
|
||||
.map_err(|_| anyhow!("Mnemonic generation error"))?;
|
||||
|
||||
println!("Mnemonic phrase: {}", *mnemonic);
|
||||
let mnemonic_with_passphrase = (mnemonic, None);
|
||||
|
||||
@@ -10,8 +10,6 @@
|
||||
// licenses.
|
||||
|
||||
extern crate bdk;
|
||||
extern crate env_logger;
|
||||
extern crate log;
|
||||
use std::error::Error;
|
||||
|
||||
use bdk::bitcoin::Network;
|
||||
@@ -29,10 +27,6 @@ use bdk::wallet::signer::SignersContainer;
|
||||
/// one of the Extend Private key.
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
env_logger::init_from_env(
|
||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||
);
|
||||
|
||||
let secp = bitcoin::secp256k1::Secp256k1::new();
|
||||
|
||||
// The descriptor used in the example
|
||||
@@ -48,7 +42,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// But they can be used as independent tools also.
|
||||
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||
|
||||
log::info!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||
println!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||
|
||||
// Create the signer with the keymap and descriptor.
|
||||
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
||||
@@ -60,7 +54,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
||||
.expect("We expect a policy");
|
||||
|
||||
log::info!("Derived Policy for the descriptor {:#?}", policy);
|
||||
println!("Derived Policy for the descriptor {:#?}", policy);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -10,7 +10,6 @@
|
||||
// licenses.
|
||||
|
||||
//! Descriptor errors
|
||||
|
||||
use core::fmt;
|
||||
|
||||
/// Errors related to the parsing and usage of descriptors
|
||||
@@ -87,9 +86,38 @@ impl fmt::Display for Error {
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||
impl_error!(bitcoin::base58::Error, Base58);
|
||||
impl_error!(bitcoin::key::Error, Pk);
|
||||
impl_error!(miniscript::Error, Miniscript);
|
||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
||||
impl From<bitcoin::bip32::Error> for Error {
|
||||
fn from(err: bitcoin::bip32::Error) -> Self {
|
||||
Error::Bip32(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::base58::Error> for Error {
|
||||
fn from(err: bitcoin::base58::Error) -> Self {
|
||||
Error::Base58(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::key::Error> for Error {
|
||||
fn from(err: bitcoin::key::Error) -> Self {
|
||||
Error::Pk(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<miniscript::Error> for Error {
|
||||
fn from(err: miniscript::Error) -> Self {
|
||||
Error::Miniscript(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::hashes::hex::Error> for Error {
|
||||
fn from(err: bitcoin::hashes::hex::Error) -> Self {
|
||||
Error::Hex(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<crate::descriptor::policy::PolicyError> for Error {
|
||||
fn from(err: crate::descriptor::policy::PolicyError) -> Self {
|
||||
Error::Policy(err)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -488,11 +488,6 @@ impl DescriptorMeta for ExtendedDescriptor {
|
||||
) {
|
||||
Some(derive_path)
|
||||
} else {
|
||||
log::debug!(
|
||||
"Key `{}` derived with {} yields an unexpected key",
|
||||
root_fingerprint,
|
||||
derive_path
|
||||
);
|
||||
None
|
||||
}
|
||||
});
|
||||
|
||||
@@ -33,13 +33,14 @@
|
||||
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
||||
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
||||
//! println!("policy: {}", serde_json::to_string(&policy).unwrap());
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::{BTreeMap, HashSet, VecDeque};
|
||||
use alloc::string::String;
|
||||
use alloc::vec::Vec;
|
||||
use core::cmp::max;
|
||||
|
||||
use core::fmt;
|
||||
|
||||
use serde::ser::SerializeMap;
|
||||
@@ -57,9 +58,6 @@ use miniscript::{
|
||||
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
||||
};
|
||||
|
||||
#[allow(unused_imports)]
|
||||
use log::{debug, error, info, trace};
|
||||
|
||||
use crate::descriptor::ExtractPolicy;
|
||||
use crate::keys::ExtScriptContext;
|
||||
use crate::wallet::signer::{SignerId, SignersContainer};
|
||||
@@ -521,7 +519,7 @@ pub enum PolicyError {
|
||||
impl fmt::Display for PolicyError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enought items selected: {}", err),
|
||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enough items selected: {}", err),
|
||||
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
||||
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
||||
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
||||
|
||||
@@ -1,201 +0,0 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use crate::bitcoin::Network;
|
||||
use crate::{descriptor, wallet};
|
||||
use alloc::{string::String, vec::Vec};
|
||||
use bitcoin::{OutPoint, Txid};
|
||||
use core::fmt;
|
||||
|
||||
/// Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||
#[derive(Debug)]
|
||||
pub enum Error {
|
||||
/// Generic error
|
||||
Generic(String),
|
||||
/// Cannot build a tx without recipients
|
||||
NoRecipients,
|
||||
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||
NoUtxosSelected,
|
||||
/// Output created is under the dust limit, 546 satoshis
|
||||
OutputBelowDustLimit(usize),
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
||||
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
||||
BnBTotalTriesExceeded,
|
||||
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
||||
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
||||
BnBNoExactMatch,
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo,
|
||||
/// Thrown when a tx is not found in the internal database
|
||||
TransactionNotFound,
|
||||
/// Happens when trying to bump a transaction that is already confirmed
|
||||
TransactionConfirmed,
|
||||
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||
IrreplaceableTransaction,
|
||||
/// When bumping a tx the fee rate requested is lower than required
|
||||
FeeRateTooLow {
|
||||
/// Required fee rate (satoshi/vbyte)
|
||||
required: crate::types::FeeRate,
|
||||
},
|
||||
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||
FeeTooLow {
|
||||
/// Required fee absolute value (satoshi)
|
||||
required: u64,
|
||||
},
|
||||
/// Node doesn't have data to estimate a fee rate
|
||||
FeeRateUnavailable,
|
||||
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||
/// explicit origin provided
|
||||
///
|
||||
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||
MissingKeyOrigin(String),
|
||||
/// Error while working with [`keys`](crate::keys)
|
||||
Key(crate::keys::KeyError),
|
||||
/// Descriptor checksum mismatch
|
||||
ChecksumMismatch,
|
||||
/// Spending policy is not compatible with this [`KeychainKind`](crate::types::KeychainKind)
|
||||
SpendingPolicyRequired(crate::types::KeychainKind),
|
||||
/// Error while extracting and manipulating policies
|
||||
InvalidPolicyPathError(crate::descriptor::policy::PolicyError),
|
||||
/// Signing error
|
||||
Signer(crate::wallet::signer::SignerError),
|
||||
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||
InvalidOutpoint(OutPoint),
|
||||
/// Error related to the parsing and usage of descriptors
|
||||
Descriptor(crate::descriptor::error::Error),
|
||||
/// Miniscript error
|
||||
Miniscript(miniscript::Error),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
/// BIP32 error
|
||||
Bip32(bitcoin::bip32::Error),
|
||||
/// Partially signed bitcoin transaction error
|
||||
Psbt(bitcoin::psbt::Error),
|
||||
}
|
||||
|
||||
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||
#[derive(Debug, Clone)]
|
||||
pub enum MiniscriptPsbtError {
|
||||
Conversion(miniscript::descriptor::ConversionError),
|
||||
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||
}
|
||||
|
||||
impl fmt::Display for MiniscriptPsbtError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for MiniscriptPsbtError {}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl fmt::Display for Error {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Generic(err) => write!(f, "Generic error: {}", err),
|
||||
Self::NoRecipients => write!(f, "Cannot build tx without recipients"),
|
||||
Self::NoUtxosSelected => write!(f, "No UTXO selected"),
|
||||
Self::OutputBelowDustLimit(limit) => {
|
||||
write!(f, "Output below the dust limit: {}", limit)
|
||||
}
|
||||
Self::InsufficientFunds { needed, available } => write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
),
|
||||
Self::BnBTotalTriesExceeded => {
|
||||
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||
}
|
||||
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||
Self::UnknownUtxo => write!(f, "UTXO not found in the internal database"),
|
||||
Self::TransactionNotFound => {
|
||||
write!(f, "Transaction not found in the internal database")
|
||||
}
|
||||
Self::TransactionConfirmed => write!(f, "Transaction already confirmed"),
|
||||
Self::IrreplaceableTransaction => write!(f, "Transaction can't be replaced"),
|
||||
Self::FeeRateTooLow { required } => write!(
|
||||
f,
|
||||
"Fee rate too low: required {} sat/vbyte",
|
||||
required.as_sat_per_vb()
|
||||
),
|
||||
Self::FeeTooLow { required } => write!(f, "Fee to low: required {} sat", required),
|
||||
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||
Self::MissingKeyOrigin(err) => write!(f, "Missing key origin: {}", err),
|
||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||
Self::ChecksumMismatch => write!(f, "Descriptor checksum mismatch"),
|
||||
Self::SpendingPolicyRequired(keychain_kind) => {
|
||||
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||
}
|
||||
Self::InvalidPolicyPathError(err) => write!(f, "Invalid policy path: {}", err),
|
||||
Self::Signer(err) => write!(f, "Signer error: {}", err),
|
||||
Self::InvalidOutpoint(outpoint) => write!(
|
||||
f,
|
||||
"Requested outpoint doesn't exist in the tx: {}",
|
||||
outpoint
|
||||
),
|
||||
Self::Descriptor(err) => write!(f, "Descriptor error: {}", err),
|
||||
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
||||
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
||||
Self::Psbt(err) => write!(f, "PSBT error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
macro_rules! impl_error {
|
||||
( $from:ty, $to:ident ) => {
|
||||
impl_error!($from, $to, Error);
|
||||
};
|
||||
( $from:ty, $to:ident, $impl_for:ty ) => {
|
||||
impl core::convert::From<$from> for $impl_for {
|
||||
fn from(err: $from) -> Self {
|
||||
<$impl_for>::$to(err)
|
||||
}
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
impl_error!(descriptor::error::Error, Descriptor);
|
||||
impl_error!(descriptor::policy::PolicyError, InvalidPolicyPathError);
|
||||
impl_error!(wallet::signer::SignerError, Signer);
|
||||
|
||||
impl From<crate::keys::KeyError> for Error {
|
||||
fn from(key_error: crate::keys::KeyError) -> Error {
|
||||
match key_error {
|
||||
crate::keys::KeyError::Miniscript(inner) => Error::Miniscript(inner),
|
||||
crate::keys::KeyError::Bip32(inner) => Error::Bip32(inner),
|
||||
crate::keys::KeyError::InvalidChecksum => Error::ChecksumMismatch,
|
||||
e => Error::Key(e),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl_error!(miniscript::Error, Miniscript);
|
||||
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
||||
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||
impl_error!(bitcoin::psbt::Error, Psbt);
|
||||
@@ -413,7 +413,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
||||
/// }
|
||||
/// ```
|
||||
///
|
||||
/// Types that don't internally encode the [`Network`](bitcoin::Network) in which they are valid need some extra
|
||||
/// Types that don't internally encode the [`Network`] in which they are valid need some extra
|
||||
/// steps to override the set of valid networks, otherwise only the network specified in the
|
||||
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
||||
///
|
||||
@@ -932,8 +932,17 @@ pub enum KeyError {
|
||||
Miniscript(miniscript::Error),
|
||||
}
|
||||
|
||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
||||
impl_error!(bitcoin::bip32::Error, Bip32, KeyError);
|
||||
impl From<miniscript::Error> for KeyError {
|
||||
fn from(err: miniscript::Error) -> Self {
|
||||
KeyError::Miniscript(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bip32::Error> for KeyError {
|
||||
fn from(err: bip32::Error) -> Self {
|
||||
KeyError::Bip32(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for KeyError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
|
||||
@@ -19,7 +19,6 @@ pub extern crate alloc;
|
||||
pub extern crate bitcoin;
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
pub extern crate hwi;
|
||||
extern crate log;
|
||||
pub extern crate miniscript;
|
||||
extern crate serde;
|
||||
extern crate serde_json;
|
||||
@@ -27,9 +26,6 @@ extern crate serde_json;
|
||||
#[cfg(feature = "keys-bip39")]
|
||||
extern crate bip39;
|
||||
|
||||
#[allow(unused_imports)]
|
||||
#[macro_use]
|
||||
pub(crate) mod error;
|
||||
pub mod descriptor;
|
||||
pub mod keys;
|
||||
pub mod psbt;
|
||||
@@ -38,7 +34,6 @@ pub mod wallet;
|
||||
|
||||
pub use descriptor::template;
|
||||
pub use descriptor::HdKeyPaths;
|
||||
pub use error::Error;
|
||||
pub use types::*;
|
||||
pub use wallet::signer;
|
||||
pub use wallet::signer::SignOptions;
|
||||
|
||||
@@ -161,7 +161,7 @@ impl Vbytes for usize {
|
||||
///
|
||||
/// [`Wallet`]: crate::Wallet
|
||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
||||
pub struct LocalUtxo {
|
||||
pub struct LocalOutput {
|
||||
/// Reference to a transaction output
|
||||
pub outpoint: OutPoint,
|
||||
/// Transaction output
|
||||
@@ -192,7 +192,7 @@ pub struct WeightedUtxo {
|
||||
/// An unspent transaction output (UTXO).
|
||||
pub enum Utxo {
|
||||
/// A UTXO owned by the local wallet.
|
||||
Local(LocalUtxo),
|
||||
Local(LocalOutput),
|
||||
/// A UTXO owned by another wallet.
|
||||
Foreign {
|
||||
/// The location of the output.
|
||||
|
||||
@@ -26,9 +26,12 @@
|
||||
//! ```
|
||||
//! # use std::str::FromStr;
|
||||
//! # use bitcoin::*;
|
||||
//! # use bdk::wallet::{self, coin_selection::*};
|
||||
//! # use bdk::wallet::{self, ChangeSet, coin_selection::*, coin_selection};
|
||||
//! # use bdk::wallet::error::CreateTxError;
|
||||
//! # use bdk_chain::PersistBackend;
|
||||
//! # use bdk::*;
|
||||
//! # use bdk::wallet::coin_selection::decide_change;
|
||||
//! # use anyhow::Error;
|
||||
//! # const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||
//! #[derive(Debug)]
|
||||
//! struct AlwaysSpendEverything;
|
||||
@@ -41,7 +44,7 @@
|
||||
//! fee_rate: bdk::FeeRate,
|
||||
//! target_amount: u64,
|
||||
//! drain_script: &Script,
|
||||
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
||||
//! ) -> Result<CoinSelectionResult, coin_selection::Error> {
|
||||
//! let mut selected_amount = 0;
|
||||
//! let mut additional_weight = Weight::ZERO;
|
||||
//! let all_utxos_selected = required_utxos
|
||||
@@ -61,7 +64,7 @@
|
||||
//! let additional_fees = fee_rate.fee_wu(additional_weight);
|
||||
//! let amount_needed_with_fees = additional_fees + target_amount;
|
||||
//! if selected_amount < amount_needed_with_fees {
|
||||
//! return Err(bdk::Error::InsufficientFunds {
|
||||
//! return Err(coin_selection::Error::InsufficientFunds {
|
||||
//! needed: amount_needed_with_fees,
|
||||
//! available: selected_amount,
|
||||
//! });
|
||||
@@ -94,19 +97,20 @@
|
||||
//!
|
||||
//! // inspect, sign, broadcast, ...
|
||||
//!
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::types::FeeRate;
|
||||
use crate::wallet::utils::IsDust;
|
||||
use crate::Utxo;
|
||||
use crate::WeightedUtxo;
|
||||
use crate::{error::Error, Utxo};
|
||||
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::consensus::encode::serialize;
|
||||
use bitcoin::{Script, Weight};
|
||||
|
||||
use core::convert::TryInto;
|
||||
use core::fmt::{self, Formatter};
|
||||
use rand::seq::SliceRandom;
|
||||
|
||||
/// Default coin selection algorithm used by [`TxBuilder`](super::tx_builder::TxBuilder) if not
|
||||
@@ -117,6 +121,43 @@ pub type DefaultCoinSelectionAlgorithm = BranchAndBoundCoinSelection;
|
||||
// prev_txid (32 bytes) + prev_vout (4 bytes) + sequence (4 bytes)
|
||||
pub(crate) const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||
|
||||
/// Errors that can be thrown by the [`coin_selection`](crate::wallet::coin_selection) module
|
||||
#[derive(Debug)]
|
||||
pub enum Error {
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
||||
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
||||
BnBNoExactMatch,
|
||||
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
||||
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
||||
BnBTotalTriesExceeded,
|
||||
}
|
||||
|
||||
impl fmt::Display for Error {
|
||||
fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::InsufficientFunds { needed, available } => write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
),
|
||||
Self::BnBTotalTriesExceeded => {
|
||||
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||
}
|
||||
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Remaining amount after performing coin selection
|
||||
pub enum Excess {
|
||||
@@ -213,12 +254,6 @@ impl CoinSelectionAlgorithm for LargestFirstCoinSelection {
|
||||
target_amount: u64,
|
||||
drain_script: &Script,
|
||||
) -> Result<CoinSelectionResult, Error> {
|
||||
log::debug!(
|
||||
"target_amount = `{}`, fee_rate = `{:?}`",
|
||||
target_amount,
|
||||
fee_rate
|
||||
);
|
||||
|
||||
// We put the "required UTXOs" first and make sure the optional UTXOs are sorted,
|
||||
// initially smallest to largest, before being reversed with `.rev()`.
|
||||
let utxos = {
|
||||
@@ -311,13 +346,6 @@ fn select_sorted_utxos(
|
||||
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||
));
|
||||
**selected_amount += weighted_utxo.utxo.txout().value;
|
||||
|
||||
log::debug!(
|
||||
"Selected {}, updated fee_amount = `{}`",
|
||||
weighted_utxo.utxo.outpoint(),
|
||||
fee_amount
|
||||
);
|
||||
|
||||
Some(weighted_utxo.utxo)
|
||||
} else {
|
||||
None
|
||||
@@ -714,7 +742,7 @@ mod test {
|
||||
.unwrap();
|
||||
WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint,
|
||||
txout: TxOut {
|
||||
value,
|
||||
@@ -774,7 +802,7 @@ mod test {
|
||||
for _ in 0..utxos_number {
|
||||
res.push(WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint: OutPoint::from_str(
|
||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
||||
)
|
||||
@@ -803,7 +831,7 @@ mod test {
|
||||
fn generate_same_value_utxos(utxos_value: u64, utxos_number: usize) -> Vec<WeightedUtxo> {
|
||||
let utxo = WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint: OutPoint::from_str(
|
||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
||||
)
|
||||
@@ -836,7 +864,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -857,7 +885,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -878,7 +906,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -900,7 +928,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 500_000 + FEE_AMOUNT;
|
||||
|
||||
LargestFirstCoinSelection::default()
|
||||
LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -918,7 +946,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
LargestFirstCoinSelection::default()
|
||||
LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -935,7 +963,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 180_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -956,7 +984,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -977,7 +1005,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -999,7 +1027,7 @@ mod test {
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 600_000 + FEE_AMOUNT;
|
||||
|
||||
OldestFirstCoinSelection::default()
|
||||
OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -1018,7 +1046,7 @@ mod test {
|
||||
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
OldestFirstCoinSelection::default()
|
||||
OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
|
||||
292
crates/bdk/src/wallet/error.rs
Normal file
292
crates/bdk/src/wallet/error.rs
Normal file
@@ -0,0 +1,292 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
//! Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||
|
||||
use crate::descriptor::policy::PolicyError;
|
||||
use crate::descriptor::DescriptorError;
|
||||
use crate::wallet::coin_selection;
|
||||
use crate::{descriptor, FeeRate, KeychainKind};
|
||||
use alloc::string::String;
|
||||
use bitcoin::{absolute, psbt, OutPoint, Sequence, Txid};
|
||||
use core::fmt;
|
||||
|
||||
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||
#[derive(Debug, Clone)]
|
||||
pub enum MiniscriptPsbtError {
|
||||
/// Descriptor key conversion error
|
||||
Conversion(miniscript::descriptor::ConversionError),
|
||||
/// Return error type for PsbtExt::update_input_with_descriptor
|
||||
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||
/// Return error type for PsbtExt::update_output_with_descriptor
|
||||
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||
}
|
||||
|
||||
impl fmt::Display for MiniscriptPsbtError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for MiniscriptPsbtError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::finish`]
|
||||
///
|
||||
/// [`TxBuilder::finish`]: crate::wallet::tx_builder::TxBuilder::finish
|
||||
pub enum CreateTxError<P> {
|
||||
/// There was a problem with the descriptors passed in
|
||||
Descriptor(DescriptorError),
|
||||
/// We were unable to write wallet data to the persistence backend
|
||||
Persist(P),
|
||||
/// There was a problem while extracting and manipulating policies
|
||||
Policy(PolicyError),
|
||||
/// Spending policy is not compatible with this [`KeychainKind`]
|
||||
SpendingPolicyRequired(KeychainKind),
|
||||
/// Requested invalid transaction version '0'
|
||||
Version0,
|
||||
/// Requested transaction version `1`, but at least `2` is needed to use OP_CSV
|
||||
Version1Csv,
|
||||
/// Requested `LockTime` is less than is required to spend from this script
|
||||
LockTime {
|
||||
/// Requested `LockTime`
|
||||
requested: absolute::LockTime,
|
||||
/// Required `LockTime`
|
||||
required: absolute::LockTime,
|
||||
},
|
||||
/// Cannot enable RBF with a `Sequence` >= 0xFFFFFFFE
|
||||
RbfSequence,
|
||||
/// Cannot enable RBF with `Sequence` given a required OP_CSV
|
||||
RbfSequenceCsv {
|
||||
/// Given RBF `Sequence`
|
||||
rbf: Sequence,
|
||||
/// Required OP_CSV `Sequence`
|
||||
csv: Sequence,
|
||||
},
|
||||
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||
FeeTooLow {
|
||||
/// Required fee absolute value (satoshi)
|
||||
required: u64,
|
||||
},
|
||||
/// When bumping a tx the fee rate requested is lower than required
|
||||
FeeRateTooLow {
|
||||
/// Required fee rate (satoshi/vbyte)
|
||||
required: FeeRate,
|
||||
},
|
||||
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||
NoUtxosSelected,
|
||||
/// Output created is under the dust limit, 546 satoshis
|
||||
OutputBelowDustLimit(usize),
|
||||
/// The `change_policy` was set but the wallet does not have a change_descriptor
|
||||
ChangePolicyDescriptor,
|
||||
/// There was an error with coin selection
|
||||
CoinSelection(coin_selection::Error),
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Cannot build a tx without recipients
|
||||
NoRecipients,
|
||||
/// Partially signed bitcoin transaction error
|
||||
Psbt(psbt::Error),
|
||||
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||
/// explicit origin provided
|
||||
///
|
||||
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||
MissingKeyOrigin(String),
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo,
|
||||
/// Missing non_witness_utxo on foreign utxo for given `OutPoint`
|
||||
MissingNonWitnessUtxo(OutPoint),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
}
|
||||
|
||||
impl<P> fmt::Display for CreateTxError<P>
|
||||
where
|
||||
P: fmt::Display,
|
||||
{
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Descriptor(e) => e.fmt(f),
|
||||
Self::Persist(e) => {
|
||||
write!(
|
||||
f,
|
||||
"failed to write wallet data to persistence backend: {}",
|
||||
e
|
||||
)
|
||||
}
|
||||
Self::Policy(e) => e.fmt(f),
|
||||
CreateTxError::SpendingPolicyRequired(keychain_kind) => {
|
||||
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||
}
|
||||
CreateTxError::Version0 => {
|
||||
write!(f, "Invalid version `0`")
|
||||
}
|
||||
CreateTxError::Version1Csv => {
|
||||
write!(
|
||||
f,
|
||||
"TxBuilder requested version `1`, but at least `2` is needed to use OP_CSV"
|
||||
)
|
||||
}
|
||||
CreateTxError::LockTime {
|
||||
requested,
|
||||
required,
|
||||
} => {
|
||||
write!(f, "TxBuilder requested timelock of `{:?}`, but at least `{:?}` is required to spend from this script", required, requested)
|
||||
}
|
||||
CreateTxError::RbfSequence => {
|
||||
write!(f, "Cannot enable RBF with a nSequence >= 0xFFFFFFFE")
|
||||
}
|
||||
CreateTxError::RbfSequenceCsv { rbf, csv } => {
|
||||
write!(
|
||||
f,
|
||||
"Cannot enable RBF with nSequence `{:?}` given a required OP_CSV of `{:?}`",
|
||||
rbf, csv
|
||||
)
|
||||
}
|
||||
CreateTxError::FeeTooLow { required } => {
|
||||
write!(f, "Fee to low: required {} sat", required)
|
||||
}
|
||||
CreateTxError::FeeRateTooLow { required } => {
|
||||
write!(
|
||||
f,
|
||||
"Fee rate too low: required {} sat/vbyte",
|
||||
required.as_sat_per_vb()
|
||||
)
|
||||
}
|
||||
CreateTxError::NoUtxosSelected => {
|
||||
write!(f, "No UTXO selected")
|
||||
}
|
||||
CreateTxError::OutputBelowDustLimit(limit) => {
|
||||
write!(f, "Output below the dust limit: {}", limit)
|
||||
}
|
||||
CreateTxError::ChangePolicyDescriptor => {
|
||||
write!(
|
||||
f,
|
||||
"The `change_policy` can be set only if the wallet has a change_descriptor"
|
||||
)
|
||||
}
|
||||
CreateTxError::CoinSelection(e) => e.fmt(f),
|
||||
CreateTxError::InsufficientFunds { needed, available } => {
|
||||
write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
)
|
||||
}
|
||||
CreateTxError::NoRecipients => {
|
||||
write!(f, "Cannot build tx without recipients")
|
||||
}
|
||||
CreateTxError::Psbt(e) => e.fmt(f),
|
||||
CreateTxError::MissingKeyOrigin(err) => {
|
||||
write!(f, "Missing key origin: {}", err)
|
||||
}
|
||||
CreateTxError::UnknownUtxo => {
|
||||
write!(f, "UTXO not found in the internal database")
|
||||
}
|
||||
CreateTxError::MissingNonWitnessUtxo(outpoint) => {
|
||||
write!(f, "Missing non_witness_utxo on foreign utxo {}", outpoint)
|
||||
}
|
||||
CreateTxError::MiniscriptPsbt(err) => {
|
||||
write!(f, "Miniscript PSBT error: {}", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<descriptor::error::Error> for CreateTxError<P> {
|
||||
fn from(err: descriptor::error::Error) -> Self {
|
||||
CreateTxError::Descriptor(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<PolicyError> for CreateTxError<P> {
|
||||
fn from(err: PolicyError) -> Self {
|
||||
CreateTxError::Policy(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<MiniscriptPsbtError> for CreateTxError<P> {
|
||||
fn from(err: MiniscriptPsbtError) -> Self {
|
||||
CreateTxError::MiniscriptPsbt(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<psbt::Error> for CreateTxError<P> {
|
||||
fn from(err: psbt::Error) -> Self {
|
||||
CreateTxError::Psbt(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<coin_selection::Error> for CreateTxError<P> {
|
||||
fn from(err: coin_selection::Error) -> Self {
|
||||
CreateTxError::CoinSelection(err)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl<P: core::fmt::Display + core::fmt::Debug> std::error::Error for CreateTxError<P> {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`Wallet::build_fee_bump`]
|
||||
///
|
||||
/// [`Wallet::build_fee_bump`]: super::Wallet::build_fee_bump
|
||||
pub enum BuildFeeBumpError {
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo(OutPoint),
|
||||
/// Thrown when a tx is not found in the internal database
|
||||
TransactionNotFound(Txid),
|
||||
/// Happens when trying to bump a transaction that is already confirmed
|
||||
TransactionConfirmed(Txid),
|
||||
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||
IrreplaceableTransaction(Txid),
|
||||
/// Node doesn't have data to estimate a fee rate
|
||||
FeeRateUnavailable,
|
||||
}
|
||||
|
||||
impl fmt::Display for BuildFeeBumpError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::UnknownUtxo(outpoint) => write!(
|
||||
f,
|
||||
"UTXO not found in the internal database with txid: {}, vout: {}",
|
||||
outpoint.txid, outpoint.vout
|
||||
),
|
||||
Self::TransactionNotFound(txid) => {
|
||||
write!(
|
||||
f,
|
||||
"Transaction not found in the internal database with txid: {}",
|
||||
txid
|
||||
)
|
||||
}
|
||||
Self::TransactionConfirmed(txid) => {
|
||||
write!(f, "Transaction already confirmed with txid: {}", txid)
|
||||
}
|
||||
Self::IrreplaceableTransaction(txid) => {
|
||||
write!(f, "Transaction can't be replaced with txid: {}", txid)
|
||||
}
|
||||
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for BuildFeeBumpError {}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -76,7 +76,7 @@
|
||||
//! Arc::new(custom_signer)
|
||||
//! );
|
||||
//!
|
||||
//! # Ok::<_, bdk::Error>(())
|
||||
//! # Ok::<_, anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::BTreeMap;
|
||||
@@ -103,6 +103,7 @@ use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||
use super::utils::SecpCtx;
|
||||
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
||||
use crate::psbt::PsbtUtils;
|
||||
use crate::wallet::error::MiniscriptPsbtError;
|
||||
|
||||
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
||||
/// multiple of them
|
||||
@@ -159,6 +160,8 @@ pub enum SignerError {
|
||||
InvalidSighash,
|
||||
/// Error while computing the hash to sign
|
||||
SighashError(sighash::Error),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
/// Error while signing using hardware wallets
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
HWIError(hwi::error::Error),
|
||||
@@ -192,6 +195,7 @@ impl fmt::Display for SignerError {
|
||||
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
||||
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
||||
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
||||
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
Self::HWIError(err) => write!(f, "Error while signing using hardware wallets: {}", err),
|
||||
}
|
||||
@@ -217,7 +221,7 @@ pub enum SignerContext {
|
||||
},
|
||||
}
|
||||
|
||||
/// Wrapper structure to pair a signer with its context
|
||||
/// Wrapper to pair a signer with its context
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct SignerWrapper<S: Sized + fmt::Debug + Clone> {
|
||||
signer: S,
|
||||
@@ -459,20 +463,23 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
||||
|
||||
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
||||
if is_internal_key
|
||||
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
||||
&& sign_options.sign_with_tap_internal_key
|
||||
{
|
||||
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
||||
sign_psbt_schnorr(
|
||||
&self.inner,
|
||||
x_only_pubkey,
|
||||
None,
|
||||
&mut psbt.inputs[input_index],
|
||||
hash,
|
||||
hash_ty,
|
||||
secp,
|
||||
);
|
||||
if let Some(psbt_internal_key) = psbt.inputs[input_index].tap_internal_key {
|
||||
if is_internal_key
|
||||
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
||||
&& sign_options.sign_with_tap_internal_key
|
||||
&& x_only_pubkey == psbt_internal_key
|
||||
{
|
||||
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
||||
sign_psbt_schnorr(
|
||||
&self.inner,
|
||||
x_only_pubkey,
|
||||
None,
|
||||
&mut psbt.inputs[input_index],
|
||||
hash,
|
||||
hash_ty,
|
||||
secp,
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some((leaf_hashes, _)) =
|
||||
@@ -751,7 +758,7 @@ pub struct SignOptions {
|
||||
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
||||
/// provided
|
||||
///
|
||||
/// Defaults to `false` to mitigate the "SegWit bug" which chould trick the wallet into
|
||||
/// Defaults to `false` to mitigate the "SegWit bug" which should trick the wallet into
|
||||
/// paying a fee larger than expected.
|
||||
///
|
||||
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
||||
|
||||
@@ -17,7 +17,11 @@
|
||||
//! # use std::str::FromStr;
|
||||
//! # use bitcoin::*;
|
||||
//! # use bdk::*;
|
||||
//! # use bdk::wallet::ChangeSet;
|
||||
//! # use bdk::wallet::error::CreateTxError;
|
||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||
//! # use bdk_chain::PersistBackend;
|
||||
//! # use anyhow::Error;
|
||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||
//! # let mut wallet = doctest_wallet!();
|
||||
//! // create a TxBuilder from a wallet
|
||||
@@ -33,7 +37,7 @@
|
||||
//! // Turn on RBF signaling
|
||||
//! .enable_rbf();
|
||||
//! let psbt = tx_builder.finish()?;
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::BTreeMap;
|
||||
@@ -41,15 +45,18 @@ use crate::collections::HashSet;
|
||||
use alloc::{boxed::Box, rc::Rc, string::String, vec::Vec};
|
||||
use bdk_chain::PersistBackend;
|
||||
use core::cell::RefCell;
|
||||
use core::fmt;
|
||||
use core::marker::PhantomData;
|
||||
|
||||
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction};
|
||||
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction, Txid};
|
||||
|
||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||
use super::ChangeSet;
|
||||
use crate::types::{FeeRate, KeychainKind, LocalUtxo, WeightedUtxo};
|
||||
use crate::{Error, Utxo, Wallet};
|
||||
use crate::types::{FeeRate, KeychainKind, LocalOutput, WeightedUtxo};
|
||||
use crate::wallet::CreateTxError;
|
||||
use crate::{Utxo, Wallet};
|
||||
|
||||
/// Context in which the [`TxBuilder`] is valid
|
||||
pub trait TxBuilderContext: core::fmt::Debug + Default + Clone {}
|
||||
|
||||
@@ -78,6 +85,10 @@ impl TxBuilderContext for BumpFee {}
|
||||
/// # use bdk::wallet::tx_builder::*;
|
||||
/// # use bitcoin::*;
|
||||
/// # use core::str::FromStr;
|
||||
/// # use bdk::wallet::ChangeSet;
|
||||
/// # use bdk::wallet::error::CreateTxError;
|
||||
/// # use bdk_chain::PersistBackend;
|
||||
/// # use anyhow::Error;
|
||||
/// # let mut wallet = doctest_wallet!();
|
||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||
/// # let addr2 = addr1.clone();
|
||||
@@ -102,7 +113,7 @@ impl TxBuilderContext for BumpFee {}
|
||||
/// };
|
||||
///
|
||||
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
///
|
||||
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
||||
@@ -182,12 +193,16 @@ impl<'a, D, Cs: Clone, Ctx> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
||||
impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D, Cs, Ctx> {
|
||||
/// Set a custom fee rate
|
||||
/// The fee_rate method sets the mining fee paid by the transaction as a rate on its size.
|
||||
/// This means that the total fee paid is equal to this rate * size of the transaction in virtual Bytes (vB) or Weigth Unit (wu).
|
||||
/// This means that the total fee paid is equal to this rate * size of the transaction in virtual Bytes (vB) or Weight Unit (wu).
|
||||
/// This rate is internally expressed in satoshis-per-virtual-bytes (sats/vB) using FeeRate::from_sat_per_vb, but can also be set by:
|
||||
/// * sats/kvB (1000 sats/kvB == 1 sats/vB) using FeeRate::from_sat_per_kvb
|
||||
/// * btc/kvB (0.00001000 btc/kvB == 1 sats/vB) using FeeRate::from_btc_per_kvb
|
||||
/// * sats/kwu (250 sats/kwu == 1 sats/vB) using FeeRate::from_sat_per_kwu
|
||||
/// Default is 1 sat/vB (see min_relay_fee)
|
||||
///
|
||||
/// Note that this is really a minimum feerate -- it's possible to
|
||||
/// overshoot it slightly since adding a change output to drain the remaining
|
||||
/// excess might not be viable.
|
||||
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
||||
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
||||
self
|
||||
@@ -198,6 +213,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// If anyone sets both the fee_absolute method and the fee_rate method,
|
||||
/// the FeePolicy enum will be set by whichever method was called last,
|
||||
/// as the FeeRate and FeeAmount are mutually exclusive.
|
||||
///
|
||||
/// Note that this is really a minimum absolute fee -- it's possible to
|
||||
/// overshoot it slightly since adding a change output to drain the remaining
|
||||
/// excess might not be viable.
|
||||
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
||||
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
||||
self
|
||||
@@ -263,7 +282,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
||||
/// .policy_path(path, KeychainKind::External);
|
||||
///
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
pub fn policy_path(
|
||||
&mut self,
|
||||
@@ -285,12 +304,16 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, Error> {
|
||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, AddUtxoError> {
|
||||
{
|
||||
let wallet = self.wallet.borrow();
|
||||
let utxos = outpoints
|
||||
.iter()
|
||||
.map(|outpoint| wallet.get_utxo(*outpoint).ok_or(Error::UnknownUtxo))
|
||||
.map(|outpoint| {
|
||||
wallet
|
||||
.get_utxo(*outpoint)
|
||||
.ok_or(AddUtxoError::UnknownUtxo(*outpoint))
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
for utxo in utxos {
|
||||
@@ -311,7 +334,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, Error> {
|
||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, AddUtxoError> {
|
||||
self.add_utxos(&[outpoint])
|
||||
}
|
||||
|
||||
@@ -366,23 +389,22 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
outpoint: OutPoint,
|
||||
psbt_input: psbt::Input,
|
||||
satisfaction_weight: usize,
|
||||
) -> Result<&mut Self, Error> {
|
||||
) -> Result<&mut Self, AddForeignUtxoError> {
|
||||
if psbt_input.witness_utxo.is_none() {
|
||||
match psbt_input.non_witness_utxo.as_ref() {
|
||||
Some(tx) => {
|
||||
if tx.txid() != outpoint.txid {
|
||||
return Err(Error::Generic(
|
||||
"Foreign utxo outpoint does not match PSBT input".into(),
|
||||
));
|
||||
return Err(AddForeignUtxoError::InvalidTxid {
|
||||
input_txid: tx.txid(),
|
||||
foreign_utxo: outpoint,
|
||||
});
|
||||
}
|
||||
if tx.output.len() <= outpoint.vout as usize {
|
||||
return Err(Error::InvalidOutpoint(outpoint));
|
||||
return Err(AddForeignUtxoError::InvalidOutpoint(outpoint));
|
||||
}
|
||||
}
|
||||
None => {
|
||||
return Err(Error::Generic(
|
||||
"Foreign utxo missing witness_utxo or non_witness_utxo".into(),
|
||||
))
|
||||
return Err(AddForeignUtxoError::MissingUtxo);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -520,7 +542,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
|
||||
/// Choose the coin selection algorithm
|
||||
///
|
||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`](super::coin_selection::DefaultCoinSelectionAlgorithm).
|
||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`].
|
||||
///
|
||||
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
||||
pub fn coin_selection<P: CoinSelectionAlgorithm>(
|
||||
@@ -537,10 +559,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
|
||||
/// Finish building the transaction.
|
||||
///
|
||||
/// Returns the [`BIP174`] "PSBT" and summary details about the transaction.
|
||||
/// Returns a new [`Psbt`] per [`BIP174`].
|
||||
///
|
||||
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
||||
pub fn finish(self) -> Result<Psbt, Error>
|
||||
pub fn finish(self) -> Result<Psbt, CreateTxError<D::WriteError>>
|
||||
where
|
||||
D: PersistBackend<ChangeSet>,
|
||||
{
|
||||
@@ -595,6 +617,90 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::add_utxo`] and [`TxBuilder::add_utxos`]
|
||||
pub enum AddUtxoError {
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo(OutPoint),
|
||||
}
|
||||
|
||||
impl fmt::Display for AddUtxoError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::UnknownUtxo(outpoint) => write!(
|
||||
f,
|
||||
"UTXO not found in the internal database for txid: {} with vout: {}",
|
||||
outpoint.txid, outpoint.vout
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AddUtxoError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::add_foreign_utxo`].
|
||||
pub enum AddForeignUtxoError {
|
||||
/// Foreign utxo outpoint txid does not match PSBT input txid
|
||||
InvalidTxid {
|
||||
/// PSBT input txid
|
||||
input_txid: Txid,
|
||||
/// Foreign UTXO outpoint
|
||||
foreign_utxo: OutPoint,
|
||||
},
|
||||
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||
InvalidOutpoint(OutPoint),
|
||||
/// Foreign utxo missing witness_utxo or non_witness_utxo
|
||||
MissingUtxo,
|
||||
}
|
||||
|
||||
impl fmt::Display for AddForeignUtxoError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::InvalidTxid {
|
||||
input_txid,
|
||||
foreign_utxo,
|
||||
} => write!(
|
||||
f,
|
||||
"Foreign UTXO outpoint txid: {} does not match PSBT input txid: {}",
|
||||
foreign_utxo.txid, input_txid,
|
||||
),
|
||||
Self::InvalidOutpoint(outpoint) => write!(
|
||||
f,
|
||||
"Requested outpoint doesn't exist for txid: {} with vout: {}",
|
||||
outpoint.txid, outpoint.vout,
|
||||
),
|
||||
Self::MissingUtxo => write!(f, "Foreign utxo missing witness_utxo or non_witness_utxo"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AddForeignUtxoError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::allow_shrinking`]
|
||||
pub enum AllowShrinkingError {
|
||||
/// Script/PubKey was not in the original transaction
|
||||
MissingScriptPubKey(ScriptBuf),
|
||||
}
|
||||
|
||||
impl fmt::Display for AllowShrinkingError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::MissingScriptPubKey(script_buf) => write!(
|
||||
f,
|
||||
"Script/PubKey was not in the original transaction: {}",
|
||||
script_buf,
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AllowShrinkingError {}
|
||||
|
||||
impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// Replace the recipients already added with a new list
|
||||
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||
@@ -639,7 +745,11 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// # use std::str::FromStr;
|
||||
/// # use bitcoin::*;
|
||||
/// # use bdk::*;
|
||||
/// # use bdk::wallet::ChangeSet;
|
||||
/// # use bdk::wallet::error::CreateTxError;
|
||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||
/// # use bdk_chain::PersistBackend;
|
||||
/// # use anyhow::Error;
|
||||
/// # let to_address =
|
||||
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||
/// .unwrap()
|
||||
@@ -655,7 +765,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||
/// .enable_rbf();
|
||||
/// let psbt = tx_builder.finish()?;
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
///
|
||||
/// [`allow_shrinking`]: Self::allow_shrinking
|
||||
@@ -680,7 +790,10 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
||||
///
|
||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||
/// transaction we are bumping.
|
||||
pub fn allow_shrinking(&mut self, script_pubkey: ScriptBuf) -> Result<&mut Self, Error> {
|
||||
pub fn allow_shrinking(
|
||||
&mut self,
|
||||
script_pubkey: ScriptBuf,
|
||||
) -> Result<&mut Self, AllowShrinkingError> {
|
||||
match self
|
||||
.params
|
||||
.recipients
|
||||
@@ -692,10 +805,7 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
||||
self.params.drain_to = Some(script_pubkey);
|
||||
Ok(self)
|
||||
}
|
||||
None => Err(Error::Generic(format!(
|
||||
"{} was not in the original transaction",
|
||||
script_pubkey
|
||||
))),
|
||||
None => Err(AllowShrinkingError::MissingScriptPubKey(script_pubkey)),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -787,7 +897,7 @@ impl Default for ChangeSpendPolicy {
|
||||
}
|
||||
|
||||
impl ChangeSpendPolicy {
|
||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalUtxo) -> bool {
|
||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalOutput) -> bool {
|
||||
match self {
|
||||
ChangeSpendPolicy::ChangeAllowed => true,
|
||||
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
||||
@@ -892,11 +1002,11 @@ mod test {
|
||||
);
|
||||
}
|
||||
|
||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
||||
fn get_test_utxos() -> Vec<LocalOutput> {
|
||||
use bitcoin::hashes::Hash;
|
||||
|
||||
vec![
|
||||
LocalUtxo {
|
||||
LocalOutput {
|
||||
outpoint: OutPoint {
|
||||
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||
vout: 0,
|
||||
@@ -907,7 +1017,7 @@ mod test {
|
||||
confirmation_time: ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||
derivation_index: 0,
|
||||
},
|
||||
LocalUtxo {
|
||||
LocalOutput {
|
||||
outpoint: OutPoint {
|
||||
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||
vout: 1,
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
#![allow(unused)]
|
||||
|
||||
use bdk::{wallet::AddressIndex, KeychainKind, LocalUtxo, Wallet};
|
||||
use bdk::{wallet::AddressIndex, KeychainKind, LocalOutput, Wallet};
|
||||
use bdk_chain::indexed_tx_graph::Indexer;
|
||||
use bdk_chain::{BlockId, ConfirmationTime};
|
||||
use bitcoin::hashes::Hash;
|
||||
|
||||
@@ -156,3 +156,37 @@ fn test_psbt_fee_rate_with_missing_txout() {
|
||||
assert!(pkh_psbt.fee_amount().is_none());
|
||||
assert!(pkh_psbt.fee_rate().is_none());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_multiple_internalkey_signers() {
|
||||
use bdk::signer::{SignerContext, SignerOrdering, SignerWrapper};
|
||||
use bdk::KeychainKind;
|
||||
use bitcoin::{secp256k1::Secp256k1, PrivateKey};
|
||||
use miniscript::psbt::PsbtExt;
|
||||
use std::sync::Arc;
|
||||
|
||||
let secp = Secp256k1::new();
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
// Adds a signer for the wrong internal key, bdk should not use this key to sign
|
||||
wallet.add_signer(
|
||||
KeychainKind::External,
|
||||
// A signerordering lower than 100, bdk will use this signer first
|
||||
SignerOrdering(0),
|
||||
Arc::new(SignerWrapper::new(
|
||||
PrivateKey::from_wif("5J5PZqvCe1uThJ3FZeUUFLCh2FuK9pZhtEK4MzhNmugqTmxCdwE").unwrap(),
|
||||
SignerContext::Tap {
|
||||
is_internal_key: true,
|
||||
},
|
||||
)),
|
||||
);
|
||||
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||
// Checks that we signed using the right key
|
||||
assert!(
|
||||
psbt.finalize_mut(&secp).is_ok(),
|
||||
"The wrong internal key was used"
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,11 +1,15 @@
|
||||
use std::str::FromStr;
|
||||
|
||||
use assert_matches::assert_matches;
|
||||
use bdk::descriptor::calc_checksum;
|
||||
use bdk::psbt::PsbtUtils;
|
||||
use bdk::signer::{SignOptions, SignerError};
|
||||
use bdk::wallet::coin_selection::LargestFirstCoinSelection;
|
||||
use bdk::wallet::coin_selection::{self, LargestFirstCoinSelection};
|
||||
use bdk::wallet::error::CreateTxError;
|
||||
use bdk::wallet::tx_builder::AddForeignUtxoError;
|
||||
use bdk::wallet::AddressIndex::*;
|
||||
use bdk::wallet::{AddressIndex, AddressInfo, Balance, Wallet};
|
||||
use bdk::{Error, FeeRate, KeychainKind};
|
||||
use bdk::{FeeRate, KeychainKind};
|
||||
use bdk_chain::COINBASE_MATURITY;
|
||||
use bdk_chain::{BlockId, ConfirmationTime};
|
||||
use bitcoin::hashes::Hash;
|
||||
@@ -17,7 +21,6 @@ use bitcoin::{
|
||||
};
|
||||
use bitcoin::{psbt, Network};
|
||||
use bitcoin::{BlockHash, Txid};
|
||||
use core::str::FromStr;
|
||||
|
||||
mod common;
|
||||
use common::*;
|
||||
@@ -42,14 +45,14 @@ fn receive_output(wallet: &mut Wallet, value: u64, height: ConfirmationTime) ->
|
||||
}
|
||||
|
||||
fn receive_output_in_latest_block(wallet: &mut Wallet, value: u64) -> OutPoint {
|
||||
let height = match wallet.latest_checkpoint() {
|
||||
Some(cp) => ConfirmationTime::Confirmed {
|
||||
height: cp.height(),
|
||||
time: 0,
|
||||
},
|
||||
None => ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||
let latest_cp = wallet.latest_checkpoint();
|
||||
let height = latest_cp.height();
|
||||
let anchor = if height == 0 {
|
||||
ConfirmationTime::Unconfirmed { last_seen: 0 }
|
||||
} else {
|
||||
ConfirmationTime::Confirmed { height, time: 0 }
|
||||
};
|
||||
receive_output(wallet, value, height)
|
||||
receive_output(wallet, value, anchor)
|
||||
}
|
||||
|
||||
// The satisfaction size of a P2WPKH is 112 WU =
|
||||
@@ -60,6 +63,101 @@ fn receive_output_in_latest_block(wallet: &mut Wallet, value: u64) -> OutPoint {
|
||||
// OP_PUSH.
|
||||
const P2WPKH_FAKE_WITNESS_SIZE: usize = 106;
|
||||
|
||||
const DB_MAGIC: &[u8] = &[0x21, 0x24, 0x48];
|
||||
|
||||
#[test]
|
||||
fn load_recovers_wallet() {
|
||||
let temp_dir = tempfile::tempdir().expect("must create tempdir");
|
||||
let file_path = temp_dir.path().join("store.db");
|
||||
|
||||
// create new wallet
|
||||
let wallet_keychains = {
|
||||
let db = bdk_file_store::Store::create_new(DB_MAGIC, &file_path).expect("must create db");
|
||||
let wallet =
|
||||
Wallet::new(get_test_wpkh(), None, db, Network::Testnet).expect("must init wallet");
|
||||
wallet.keychains().clone()
|
||||
};
|
||||
|
||||
// recover wallet
|
||||
{
|
||||
let db = bdk_file_store::Store::open(DB_MAGIC, &file_path).expect("must recover db");
|
||||
let wallet = Wallet::load(get_test_wpkh(), None, db).expect("must recover wallet");
|
||||
assert_eq!(wallet.network(), Network::Testnet);
|
||||
assert_eq!(wallet.spk_index().keychains(), &wallet_keychains);
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn new_or_load() {
|
||||
let temp_dir = tempfile::tempdir().expect("must create tempdir");
|
||||
let file_path = temp_dir.path().join("store.db");
|
||||
|
||||
// init wallet when non-existant
|
||||
let wallet_keychains = {
|
||||
let db = bdk_file_store::Store::open_or_create_new(DB_MAGIC, &file_path)
|
||||
.expect("must create db");
|
||||
let wallet = Wallet::new_or_load(get_test_wpkh(), None, db, Network::Testnet)
|
||||
.expect("must init wallet");
|
||||
wallet.keychains().clone()
|
||||
};
|
||||
|
||||
// wrong network
|
||||
{
|
||||
let db =
|
||||
bdk_file_store::Store::open_or_create_new(DB_MAGIC, &file_path).expect("must open db");
|
||||
let err = Wallet::new_or_load(get_test_wpkh(), None, db, Network::Bitcoin)
|
||||
.expect_err("wrong network");
|
||||
assert!(
|
||||
matches!(
|
||||
err,
|
||||
bdk::wallet::NewOrLoadError::LoadedNetworkDoesNotMatch {
|
||||
got: Some(Network::Testnet),
|
||||
expected: Network::Bitcoin
|
||||
}
|
||||
),
|
||||
"err: {}",
|
||||
err,
|
||||
);
|
||||
}
|
||||
|
||||
// wrong genesis hash
|
||||
{
|
||||
let exp_blockhash = BlockHash::all_zeros();
|
||||
let got_blockhash =
|
||||
bitcoin::blockdata::constants::genesis_block(Network::Testnet).block_hash();
|
||||
|
||||
let db =
|
||||
bdk_file_store::Store::open_or_create_new(DB_MAGIC, &file_path).expect("must open db");
|
||||
let err = Wallet::new_or_load_with_genesis_hash(
|
||||
get_test_wpkh(),
|
||||
None,
|
||||
db,
|
||||
Network::Testnet,
|
||||
exp_blockhash,
|
||||
)
|
||||
.expect_err("wrong genesis hash");
|
||||
assert!(
|
||||
matches!(
|
||||
err,
|
||||
bdk::wallet::NewOrLoadError::LoadedGenesisDoesNotMatch { got, expected }
|
||||
if got == Some(got_blockhash) && expected == exp_blockhash
|
||||
),
|
||||
"err: {}",
|
||||
err,
|
||||
);
|
||||
}
|
||||
|
||||
// all parameters match
|
||||
{
|
||||
let db =
|
||||
bdk_file_store::Store::open_or_create_new(DB_MAGIC, &file_path).expect("must open db");
|
||||
let wallet = Wallet::new_or_load(get_test_wpkh(), None, db, Network::Testnet)
|
||||
.expect("must recover wallet");
|
||||
assert_eq!(wallet.network(), Network::Testnet);
|
||||
assert_eq!(wallet.keychains(), &wallet_keychains);
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_descriptor_checksum() {
|
||||
let (wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
@@ -139,6 +237,25 @@ fn test_get_funded_wallet_tx_fee_rate() {
|
||||
assert_eq!(tx_fee_rate.as_sat_per_vb(), 8.849558);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_list_output() {
|
||||
let (wallet, txid) = get_funded_wallet(get_test_wpkh());
|
||||
let txos = wallet
|
||||
.list_output()
|
||||
.map(|op| (op.outpoint, op))
|
||||
.collect::<std::collections::BTreeMap<_, _>>();
|
||||
assert_eq!(txos.len(), 2);
|
||||
for (op, txo) in txos {
|
||||
if op.txid == txid {
|
||||
assert_eq!(txo.txout.value, 50_000);
|
||||
assert!(!txo.is_spent);
|
||||
} else {
|
||||
assert_eq!(txo.txout.value, 76_000);
|
||||
assert!(txo.is_spent);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
macro_rules! assert_fee_rate {
|
||||
($psbt:expr, $fees:expr, $fee_rate:expr $( ,@dust_change $( $dust_change:expr )* )* $( ,@add_signature $( $add_signature:expr )* )* ) => ({
|
||||
let psbt = $psbt.clone();
|
||||
@@ -213,7 +330,6 @@ fn test_create_tx_manually_selected_empty_utxos() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "Invalid version `0`")]
|
||||
fn test_create_tx_version_0() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -221,13 +337,10 @@ fn test_create_tx_version_0() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.version(0);
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(builder.finish(), Err(CreateTxError::Version0)));
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(
|
||||
expected = "TxBuilder requested version `1`, but at least `2` is needed to use OP_CSV"
|
||||
)]
|
||||
fn test_create_tx_version_1_csv() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_single_sig_csv());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -235,7 +348,7 @@ fn test_create_tx_version_1_csv() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.version(1);
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(builder.finish(), Err(CreateTxError::Version1Csv)));
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -277,7 +390,7 @@ fn test_create_tx_fee_sniping_locktime_last_sync() {
|
||||
// If there's no current_height we're left with using the last sync height
|
||||
assert_eq!(
|
||||
psbt.unsigned_tx.lock_time.to_consensus_u32(),
|
||||
wallet.latest_checkpoint().unwrap().height()
|
||||
wallet.latest_checkpoint().height()
|
||||
);
|
||||
}
|
||||
|
||||
@@ -323,9 +436,6 @@ fn test_create_tx_custom_locktime_compatible_with_cltv() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(
|
||||
expected = "TxBuilder requested timelock of `Blocks(Height(50000))`, but at least `Blocks(Height(100000))` is required to spend from this script"
|
||||
)]
|
||||
fn test_create_tx_custom_locktime_incompatible_with_cltv() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_single_sig_cltv());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -333,7 +443,9 @@ fn test_create_tx_custom_locktime_incompatible_with_cltv() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.nlocktime(absolute::LockTime::from_height(50000).unwrap());
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(builder.finish(),
|
||||
Err(CreateTxError::LockTime { requested, required })
|
||||
if requested.to_consensus_u32() == 50_000 && required.to_consensus_u32() == 100_000));
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -362,9 +474,6 @@ fn test_create_tx_with_default_rbf_csv() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(
|
||||
expected = "Cannot enable RBF with nSequence `Sequence(3)` given a required OP_CSV of `Sequence(6)`"
|
||||
)]
|
||||
fn test_create_tx_with_custom_rbf_csv() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_single_sig_csv());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -372,7 +481,9 @@ fn test_create_tx_with_custom_rbf_csv() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.enable_rbf_with_sequence(Sequence(3));
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(builder.finish(),
|
||||
Err(CreateTxError::RbfSequenceCsv { rbf, csv })
|
||||
if rbf.to_consensus_u32() == 3 && csv.to_consensus_u32() == 6));
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -387,7 +498,6 @@ fn test_create_tx_no_rbf_cltv() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "Cannot enable RBF with a nSequence >= 0xFFFFFFFE")]
|
||||
fn test_create_tx_invalid_rbf_sequence() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -395,7 +505,7 @@ fn test_create_tx_invalid_rbf_sequence() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.enable_rbf_with_sequence(Sequence(0xFFFFFFFE));
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(builder.finish(), Err(CreateTxError::RbfSequence)));
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -423,9 +533,6 @@ fn test_create_tx_default_sequence() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(
|
||||
expected = "The `change_policy` can be set only if the wallet has a change_descriptor"
|
||||
)]
|
||||
fn test_create_tx_change_policy_no_internal() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let addr = wallet.get_address(New);
|
||||
@@ -433,7 +540,10 @@ fn test_create_tx_change_policy_no_internal() {
|
||||
builder
|
||||
.add_recipient(addr.script_pubkey(), 25_000)
|
||||
.do_not_spend_change();
|
||||
builder.finish().unwrap();
|
||||
assert!(matches!(
|
||||
builder.finish(),
|
||||
Err(CreateTxError::ChangePolicyDescriptor)
|
||||
));
|
||||
}
|
||||
|
||||
macro_rules! check_fee {
|
||||
@@ -1140,7 +1250,6 @@ fn test_calculate_fee_with_missing_foreign_utxo() {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "Generic(\"Foreign utxo missing witness_utxo or non_witness_utxo\")")]
|
||||
fn test_add_foreign_utxo_invalid_psbt_input() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let outpoint = wallet.list_unspent().next().expect("must exist").outpoint;
|
||||
@@ -1151,9 +1260,9 @@ fn test_add_foreign_utxo_invalid_psbt_input() {
|
||||
.unwrap();
|
||||
|
||||
let mut builder = wallet.build_tx();
|
||||
builder
|
||||
.add_foreign_utxo(outpoint, psbt::Input::default(), foreign_utxo_satisfaction)
|
||||
.unwrap();
|
||||
let result =
|
||||
builder.add_foreign_utxo(outpoint, psbt::Input::default(), foreign_utxo_satisfaction);
|
||||
assert!(matches!(result, Err(AddForeignUtxoError::MissingUtxo)));
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -1197,7 +1306,7 @@ fn test_add_foreign_utxo_where_outpoint_doesnt_match_psbt_input() {
|
||||
satisfaction_weight
|
||||
)
|
||||
.is_ok(),
|
||||
"shoulld be ok when outpoint does match psbt_input"
|
||||
"should be ok when outpoint does match psbt_input"
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1615,7 +1724,7 @@ fn test_bump_fee_drain_wallet() {
|
||||
.insert_tx(
|
||||
tx.clone(),
|
||||
ConfirmationTime::Confirmed {
|
||||
height: wallet.latest_checkpoint().unwrap().height(),
|
||||
height: wallet.latest_checkpoint().height(),
|
||||
time: 42_000,
|
||||
},
|
||||
)
|
||||
@@ -1917,7 +2026,7 @@ fn test_bump_fee_add_input_change_dust() {
|
||||
|
||||
let mut tx = psbt.extract_tx();
|
||||
for txin in &mut tx.input {
|
||||
txin.witness.push([0x00; P2WPKH_FAKE_WITNESS_SIZE]); // to get realisitc weight
|
||||
txin.witness.push([0x00; P2WPKH_FAKE_WITNESS_SIZE]); // to get realistic weight
|
||||
}
|
||||
let original_tx_weight = tx.weight();
|
||||
assert_eq!(tx.input.len(), 1);
|
||||
@@ -2435,7 +2544,7 @@ fn test_sign_nonstandard_sighash() {
|
||||
);
|
||||
assert_matches!(
|
||||
result,
|
||||
Err(bdk::Error::Signer(SignerError::NonStandardSighash)),
|
||||
Err(SignerError::NonStandardSighash),
|
||||
"Signing failed with the wrong error type"
|
||||
);
|
||||
|
||||
@@ -2852,7 +2961,7 @@ fn test_taproot_sign_missing_witness_utxo() {
|
||||
);
|
||||
assert_matches!(
|
||||
result,
|
||||
Err(Error::Signer(SignerError::MissingWitnessUtxo)),
|
||||
Err(SignerError::MissingWitnessUtxo),
|
||||
"Signing should have failed with the correct error because the witness_utxo is missing"
|
||||
);
|
||||
|
||||
@@ -3085,7 +3194,7 @@ fn test_taproot_script_spend_sign_exclude_some_leaves() {
|
||||
.values()
|
||||
.map(|(script, version)| TapLeafHash::from_script(script, *version))
|
||||
.collect();
|
||||
let included_script_leaves = vec![script_leaves.pop().unwrap()];
|
||||
let included_script_leaves = [script_leaves.pop().unwrap()];
|
||||
let excluded_script_leaves = script_leaves;
|
||||
|
||||
assert!(
|
||||
@@ -3193,7 +3302,7 @@ fn test_taproot_sign_non_default_sighash() {
|
||||
);
|
||||
assert_matches!(
|
||||
result,
|
||||
Err(Error::Signer(SignerError::NonStandardSighash)),
|
||||
Err(SignerError::NonStandardSighash),
|
||||
"Signing failed with the wrong error type"
|
||||
);
|
||||
|
||||
@@ -3211,7 +3320,7 @@ fn test_taproot_sign_non_default_sighash() {
|
||||
);
|
||||
assert_matches!(
|
||||
result,
|
||||
Err(Error::Signer(SignerError::MissingWitnessUtxo)),
|
||||
Err(SignerError::MissingWitnessUtxo),
|
||||
"Signing failed with the wrong error type"
|
||||
);
|
||||
|
||||
@@ -3299,10 +3408,12 @@ fn test_spend_coinbase() {
|
||||
.current_height(confirmation_height);
|
||||
assert!(matches!(
|
||||
builder.finish(),
|
||||
Err(Error::InsufficientFunds {
|
||||
needed: _,
|
||||
available: 0
|
||||
})
|
||||
Err(CreateTxError::CoinSelection(
|
||||
coin_selection::Error::InsufficientFunds {
|
||||
needed: _,
|
||||
available: 0
|
||||
}
|
||||
))
|
||||
));
|
||||
|
||||
// Still unspendable...
|
||||
@@ -3312,10 +3423,12 @@ fn test_spend_coinbase() {
|
||||
.current_height(not_yet_mature_time);
|
||||
assert_matches!(
|
||||
builder.finish(),
|
||||
Err(Error::InsufficientFunds {
|
||||
needed: _,
|
||||
available: 0
|
||||
})
|
||||
Err(CreateTxError::CoinSelection(
|
||||
coin_selection::Error::InsufficientFunds {
|
||||
needed: _,
|
||||
available: 0
|
||||
}
|
||||
))
|
||||
);
|
||||
|
||||
wallet
|
||||
@@ -3351,7 +3464,10 @@ fn test_allow_dust_limit() {
|
||||
|
||||
builder.add_recipient(addr.script_pubkey(), 0);
|
||||
|
||||
assert_matches!(builder.finish(), Err(Error::OutputBelowDustLimit(0)));
|
||||
assert_matches!(
|
||||
builder.finish(),
|
||||
Err(CreateTxError::OutputBelowDustLimit(0))
|
||||
);
|
||||
|
||||
let mut builder = wallet.build_tx();
|
||||
|
||||
|
||||
@@ -2,6 +2,13 @@
|
||||
name = "bdk_bitcoind_rpc"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
rust-version = "1.63"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_bitcoind_rpc"
|
||||
description = "This crate is used for emitting blockchain data from the `bitcoind` RPC interface."
|
||||
license = "MIT OR Apache-2.0"
|
||||
readme = "README.md"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
|
||||
3
crates/bitcoind_rpc/README.md
Normal file
3
crates/bitcoind_rpc/README.md
Normal file
@@ -0,0 +1,3 @@
|
||||
# BDK Bitcoind RPC
|
||||
|
||||
This crate is used for emitting blockchain data from the `bitcoind` RPC interface.
|
||||
@@ -14,7 +14,7 @@ use bitcoin::{block::Header, Block, BlockHash, Transaction};
|
||||
pub use bitcoincore_rpc;
|
||||
use bitcoincore_rpc::bitcoincore_rpc_json;
|
||||
|
||||
/// A structure that emits data sourced from [`bitcoincore_rpc::Client`].
|
||||
/// The [`Emitter`] is used to emit data sourced from [`bitcoincore_rpc::Client`].
|
||||
///
|
||||
/// Refer to [module-level documentation] for more.
|
||||
///
|
||||
@@ -25,7 +25,7 @@ pub struct Emitter<'c, C> {
|
||||
|
||||
/// The checkpoint of the last-emitted block that is in the best chain. If it is later found
|
||||
/// that the block is no longer in the best chain, it will be popped off from here.
|
||||
last_cp: Option<CheckPoint>,
|
||||
last_cp: CheckPoint,
|
||||
|
||||
/// The block result returned from rpc of the last-emitted block. As this result contains the
|
||||
/// next block's block hash (which we use to fetch the next block), we set this to `None`
|
||||
@@ -43,29 +43,16 @@ pub struct Emitter<'c, C> {
|
||||
}
|
||||
|
||||
impl<'c, C: bitcoincore_rpc::RpcApi> Emitter<'c, C> {
|
||||
/// Construct a new [`Emitter`] with the given RPC `client` and `start_height`.
|
||||
/// Construct a new [`Emitter`] with the given RPC `client`, `last_cp` and `start_height`.
|
||||
///
|
||||
/// `start_height` is the block height to start emitting blocks from.
|
||||
pub fn from_height(client: &'c C, start_height: u32) -> Self {
|
||||
/// * `last_cp` is the check point used to find the latest block which is still part of the best
|
||||
/// chain.
|
||||
/// * `start_height` is the block height to start emitting blocks from.
|
||||
pub fn new(client: &'c C, last_cp: CheckPoint, start_height: u32) -> Self {
|
||||
Self {
|
||||
client,
|
||||
start_height,
|
||||
last_cp: None,
|
||||
last_block: None,
|
||||
last_mempool_time: 0,
|
||||
last_mempool_tip: None,
|
||||
}
|
||||
}
|
||||
|
||||
/// Construct a new [`Emitter`] with the given RPC `client` and `checkpoint`.
|
||||
///
|
||||
/// `checkpoint` is used to find the latest block which is still part of the best chain. The
|
||||
/// [`Emitter`] will emit blocks starting right above this block.
|
||||
pub fn from_checkpoint(client: &'c C, checkpoint: CheckPoint) -> Self {
|
||||
Self {
|
||||
client,
|
||||
start_height: 0,
|
||||
last_cp: Some(checkpoint),
|
||||
last_cp,
|
||||
last_block: None,
|
||||
last_mempool_time: 0,
|
||||
last_mempool_tip: None,
|
||||
@@ -134,7 +121,7 @@ impl<'c, C: bitcoincore_rpc::RpcApi> Emitter<'c, C> {
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
self.last_mempool_time = latest_time;
|
||||
self.last_mempool_tip = self.last_cp.as_ref().map(|cp| cp.height());
|
||||
self.last_mempool_tip = Some(self.last_cp.height());
|
||||
|
||||
Ok(txs_to_emit)
|
||||
}
|
||||
@@ -156,7 +143,8 @@ enum PollResponse {
|
||||
/// Fetched block is not in the best chain.
|
||||
BlockNotInBestChain,
|
||||
AgreementFound(bitcoincore_rpc_json::GetBlockResult, CheckPoint),
|
||||
AgreementPointNotFound,
|
||||
/// Force the genesis checkpoint down the receiver's throat.
|
||||
AgreementPointNotFound(BlockHash),
|
||||
}
|
||||
|
||||
fn poll_once<C>(emitter: &Emitter<C>) -> Result<PollResponse, bitcoincore_rpc::Error>
|
||||
@@ -166,45 +154,50 @@ where
|
||||
let client = emitter.client;
|
||||
|
||||
if let Some(last_res) = &emitter.last_block {
|
||||
assert!(
|
||||
emitter.last_cp.is_some(),
|
||||
"must not have block result without last cp"
|
||||
);
|
||||
|
||||
let next_hash = match last_res.nextblockhash {
|
||||
None => return Ok(PollResponse::NoMoreBlocks),
|
||||
Some(next_hash) => next_hash,
|
||||
let next_hash = if last_res.height < emitter.start_height as _ {
|
||||
// enforce start height
|
||||
let next_hash = client.get_block_hash(emitter.start_height as _)?;
|
||||
// make sure last emission is still in best chain
|
||||
if client.get_block_hash(last_res.height as _)? != last_res.hash {
|
||||
return Ok(PollResponse::BlockNotInBestChain);
|
||||
}
|
||||
next_hash
|
||||
} else {
|
||||
match last_res.nextblockhash {
|
||||
None => return Ok(PollResponse::NoMoreBlocks),
|
||||
Some(next_hash) => next_hash,
|
||||
}
|
||||
};
|
||||
|
||||
let res = client.get_block_info(&next_hash)?;
|
||||
if res.confirmations < 0 {
|
||||
return Ok(PollResponse::BlockNotInBestChain);
|
||||
}
|
||||
|
||||
return Ok(PollResponse::Block(res));
|
||||
}
|
||||
|
||||
if emitter.last_cp.is_none() {
|
||||
let hash = client.get_block_hash(emitter.start_height as _)?;
|
||||
|
||||
let res = client.get_block_info(&hash)?;
|
||||
if res.confirmations < 0 {
|
||||
return Ok(PollResponse::BlockNotInBestChain);
|
||||
}
|
||||
return Ok(PollResponse::Block(res));
|
||||
}
|
||||
|
||||
for cp in emitter.last_cp.iter().flat_map(CheckPoint::iter) {
|
||||
let res = client.get_block_info(&cp.hash())?;
|
||||
if res.confirmations < 0 {
|
||||
// block is not in best chain
|
||||
continue;
|
||||
}
|
||||
for cp in emitter.last_cp.iter() {
|
||||
let res = match client.get_block_info(&cp.hash()) {
|
||||
// block not in best chain
|
||||
Ok(res) if res.confirmations < 0 => continue,
|
||||
Ok(res) => res,
|
||||
Err(e) if e.is_not_found_error() => {
|
||||
if cp.height() > 0 {
|
||||
continue;
|
||||
}
|
||||
// if we can't find genesis block, we can't create an update that connects
|
||||
break;
|
||||
}
|
||||
Err(e) => return Err(e),
|
||||
};
|
||||
|
||||
// agreement point found
|
||||
return Ok(PollResponse::AgreementFound(res, cp));
|
||||
}
|
||||
|
||||
Ok(PollResponse::AgreementPointNotFound)
|
||||
let genesis_hash = client.get_block_hash(0)?;
|
||||
Ok(PollResponse::AgreementPointNotFound(genesis_hash))
|
||||
}
|
||||
|
||||
fn poll<C, V, F>(
|
||||
@@ -222,25 +215,12 @@ where
|
||||
let hash = res.hash;
|
||||
let item = get_item(&hash)?;
|
||||
|
||||
let this_id = BlockId { height, hash };
|
||||
let prev_id = res.previousblockhash.map(|prev_hash| BlockId {
|
||||
height: height - 1,
|
||||
hash: prev_hash,
|
||||
});
|
||||
|
||||
match (&mut emitter.last_cp, prev_id) {
|
||||
(Some(cp), _) => *cp = cp.clone().push(this_id).expect("must push"),
|
||||
(last_cp, None) => *last_cp = Some(CheckPoint::new(this_id)),
|
||||
// When the receiver constructs a local_chain update from a block, the previous
|
||||
// checkpoint is also included in the update. We need to reflect this state in
|
||||
// `Emitter::last_cp` as well.
|
||||
(last_cp, Some(prev_id)) => {
|
||||
*last_cp = Some(CheckPoint::new(prev_id).push(this_id).expect("must push"))
|
||||
}
|
||||
}
|
||||
|
||||
emitter.last_cp = emitter
|
||||
.last_cp
|
||||
.clone()
|
||||
.push(BlockId { height, hash })
|
||||
.expect("must push");
|
||||
emitter.last_block = Some(res);
|
||||
|
||||
return Ok(Some((height, item)));
|
||||
}
|
||||
PollResponse::NoMoreBlocks => {
|
||||
@@ -254,9 +234,6 @@ where
|
||||
PollResponse::AgreementFound(res, cp) => {
|
||||
let agreement_h = res.height as u32;
|
||||
|
||||
// get rid of evicted blocks
|
||||
emitter.last_cp = Some(cp);
|
||||
|
||||
// The tip during the last mempool emission needs to in the best chain, we reduce
|
||||
// it if it is not.
|
||||
if let Some(h) = emitter.last_mempool_tip.as_mut() {
|
||||
@@ -264,15 +241,17 @@ where
|
||||
*h = agreement_h;
|
||||
}
|
||||
}
|
||||
|
||||
// get rid of evicted blocks
|
||||
emitter.last_cp = cp;
|
||||
emitter.last_block = Some(res);
|
||||
continue;
|
||||
}
|
||||
PollResponse::AgreementPointNotFound => {
|
||||
// We want to clear `last_cp` and set `start_height` to the first checkpoint's
|
||||
// height. This way, the first checkpoint in `LocalChain` can be replaced.
|
||||
if let Some(last_cp) = emitter.last_cp.take() {
|
||||
emitter.start_height = last_cp.height();
|
||||
}
|
||||
PollResponse::AgreementPointNotFound(genesis_hash) => {
|
||||
emitter.last_cp = CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: genesis_hash,
|
||||
});
|
||||
emitter.last_block = None;
|
||||
continue;
|
||||
}
|
||||
|
||||
@@ -188,8 +188,8 @@ fn block_to_chain_update(block: &bitcoin::Block, height: u32) -> local_chain::Up
|
||||
#[test]
|
||||
pub fn test_sync_local_chain() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let mut local_chain = LocalChain::default();
|
||||
let mut emitter = Emitter::from_height(&env.client, 0);
|
||||
let (mut local_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut emitter = Emitter::new(&env.client, local_chain.tip(), 0);
|
||||
|
||||
// mine some blocks and returned the actual block hashes
|
||||
let exp_hashes = {
|
||||
@@ -296,7 +296,7 @@ fn test_into_tx_graph() -> anyhow::Result<()> {
|
||||
env.mine_blocks(101, None)?;
|
||||
println!("mined blocks!");
|
||||
|
||||
let mut chain = LocalChain::default();
|
||||
let (mut chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut indexed_tx_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||
let mut index = SpkTxOutIndex::<usize>::default();
|
||||
index.insert_spk(0, addr_0.script_pubkey());
|
||||
@@ -305,7 +305,7 @@ fn test_into_tx_graph() -> anyhow::Result<()> {
|
||||
index
|
||||
});
|
||||
|
||||
let emitter = &mut Emitter::from_height(&env.client, 0);
|
||||
let emitter = &mut Emitter::new(&env.client, chain.tip(), 0);
|
||||
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
let _ = chain.apply_update(block_to_chain_update(&block, height))?;
|
||||
@@ -393,7 +393,14 @@ fn ensure_block_emitted_after_reorg_is_at_reorg_height() -> anyhow::Result<()> {
|
||||
const CHAIN_TIP_HEIGHT: usize = 110;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::from_height(&env.client, EMITTER_START_HEIGHT as _);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
EMITTER_START_HEIGHT as _,
|
||||
);
|
||||
|
||||
env.mine_blocks(CHAIN_TIP_HEIGHT, None)?;
|
||||
while emitter.next_header()?.is_some() {}
|
||||
@@ -442,9 +449,7 @@ fn get_balance(
|
||||
recv_chain: &LocalChain,
|
||||
recv_graph: &IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||
) -> anyhow::Result<Balance> {
|
||||
let chain_tip = recv_chain
|
||||
.tip()
|
||||
.map_or(BlockId::default(), |cp| cp.block_id());
|
||||
let chain_tip = recv_chain.tip().block_id();
|
||||
let outpoints = recv_graph.index.outpoints().clone();
|
||||
let balance = recv_graph
|
||||
.graph()
|
||||
@@ -461,7 +466,14 @@ fn tx_can_become_unconfirmed_after_reorg() -> anyhow::Result<()> {
|
||||
const SEND_AMOUNT: Amount = Amount::from_sat(10_000);
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::from_height(&env.client, 0);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// setup addresses
|
||||
let addr_to_mine = env.client.get_new_address(None, None)?.assume_checked();
|
||||
@@ -469,7 +481,7 @@ fn tx_can_become_unconfirmed_after_reorg() -> anyhow::Result<()> {
|
||||
let addr_to_track = Address::from_script(&spk_to_track, bitcoin::Network::Regtest)?;
|
||||
|
||||
// setup receiver
|
||||
let mut recv_chain = LocalChain::default();
|
||||
let (mut recv_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut recv_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||
let mut recv_index = SpkTxOutIndex::default();
|
||||
recv_index.insert_spk((), spk_to_track.clone());
|
||||
@@ -542,7 +554,14 @@ fn mempool_avoids_re_emission() -> anyhow::Result<()> {
|
||||
const MEMPOOL_TX_COUNT: usize = 2;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::from_height(&env.client, 0);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks and sync up emitter
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
@@ -597,7 +616,14 @@ fn mempool_re_emits_if_tx_introduction_height_not_reached() -> anyhow::Result<()
|
||||
const MEMPOOL_TX_COUNT: usize = 21;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::from_height(&env.client, 0);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks to get initial balance, sync emitter up to tip
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
@@ -674,7 +700,14 @@ fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||
const PREMINE_COUNT: usize = 101;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::from_height(&env.client, 0);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks to get initial balance
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
@@ -702,7 +735,7 @@ fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||
"first mempool emission should include all txs",
|
||||
);
|
||||
|
||||
// perform reorgs at different heights, these reorgs will not comfirm transactions in the
|
||||
// perform reorgs at different heights, these reorgs will not confirm transactions in the
|
||||
// mempool
|
||||
for reorg_count in 1..TIP_DIFF {
|
||||
println!("REORG COUNT: {}", reorg_count);
|
||||
@@ -775,10 +808,10 @@ fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||
/// If blockchain re-org includes the start height, emit new start height block
|
||||
///
|
||||
/// 1. mine 101 blocks
|
||||
/// 2. emmit blocks 99a, 100a
|
||||
/// 2. emit blocks 99a, 100a
|
||||
/// 3. invalidate blocks 99a, 100a, 101a
|
||||
/// 4. mine new blocks 99b, 100b, 101b
|
||||
/// 5. emmit block 99b
|
||||
/// 5. emit block 99b
|
||||
///
|
||||
/// The block hash of 99b should be different than 99a, but their previous block hashes should
|
||||
/// be the same.
|
||||
@@ -789,7 +822,14 @@ fn no_agreement_point() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
|
||||
// start height is 99
|
||||
let mut emitter = Emitter::from_height(&env.client, (PREMINE_COUNT - 2) as u32);
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
(PREMINE_COUNT - 2) as u32,
|
||||
);
|
||||
|
||||
// mine 101 blocks
|
||||
env.mine_blocks(PREMINE_COUNT, None)?;
|
||||
|
||||
@@ -2,7 +2,7 @@
|
||||
name = "bdk_chain"
|
||||
version = "0.6.0"
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
rust-version = "1.63"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_chain"
|
||||
@@ -18,8 +18,8 @@ bitcoin = { version = "0.30.0", default-features = false }
|
||||
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
||||
|
||||
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
||||
# note version 0.13 breaks outs MSRV.
|
||||
hashbrown = { version = "0.11", optional = true, features = ["serde"] }
|
||||
# note versions > 0.9.1 breaks ours 1.57.0 MSRV.
|
||||
hashbrown = { version = "0.9.1", optional = true, features = ["serde"] }
|
||||
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
|
||||
@@ -74,8 +74,8 @@ impl ConfirmationTime {
|
||||
}
|
||||
}
|
||||
|
||||
impl From<ChainPosition<ConfirmationTimeAnchor>> for ConfirmationTime {
|
||||
fn from(observed_as: ChainPosition<ConfirmationTimeAnchor>) -> Self {
|
||||
impl From<ChainPosition<ConfirmationTimeHeightAnchor>> for ConfirmationTime {
|
||||
fn from(observed_as: ChainPosition<ConfirmationTimeHeightAnchor>) -> Self {
|
||||
match observed_as {
|
||||
ChainPosition::Confirmed(a) => Self::Confirmed {
|
||||
height: a.confirmation_height,
|
||||
@@ -147,6 +147,8 @@ impl From<(&u32, &BlockHash)> for BlockId {
|
||||
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation height of the transaction.
|
||||
///
|
||||
/// Note that the confirmation block and the anchor block can be different here.
|
||||
///
|
||||
/// Refer to [`Anchor`] for more details.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
@@ -186,6 +188,8 @@ impl AnchorFromBlockPosition for ConfirmationHeightAnchor {
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation time and height of the
|
||||
/// transaction.
|
||||
///
|
||||
/// Note that the confirmation block and the anchor block can be different here.
|
||||
///
|
||||
/// Refer to [`Anchor`] for more details.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
@@ -193,7 +197,7 @@ impl AnchorFromBlockPosition for ConfirmationHeightAnchor {
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub struct ConfirmationTimeAnchor {
|
||||
pub struct ConfirmationTimeHeightAnchor {
|
||||
/// The anchor block.
|
||||
pub anchor_block: BlockId,
|
||||
/// The confirmation height of the chain data being anchored.
|
||||
@@ -202,7 +206,7 @@ pub struct ConfirmationTimeAnchor {
|
||||
pub confirmation_time: u64,
|
||||
}
|
||||
|
||||
impl Anchor for ConfirmationTimeAnchor {
|
||||
impl Anchor for ConfirmationTimeHeightAnchor {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
self.anchor_block
|
||||
}
|
||||
@@ -212,7 +216,7 @@ impl Anchor for ConfirmationTimeAnchor {
|
||||
}
|
||||
}
|
||||
|
||||
impl AnchorFromBlockPosition for ConfirmationTimeAnchor {
|
||||
impl AnchorFromBlockPosition for ConfirmationTimeHeightAnchor {
|
||||
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||
Self {
|
||||
anchor_block: block_id,
|
||||
|
||||
@@ -3,7 +3,7 @@ use crate::BlockId;
|
||||
/// Represents a service that tracks the blockchain.
|
||||
///
|
||||
/// The main method is [`is_block_in_chain`] which determines whether a given block of [`BlockId`]
|
||||
/// is an ancestor of another "static block".
|
||||
/// is an ancestor of the `chain_tip`.
|
||||
///
|
||||
/// [`is_block_in_chain`]: Self::is_block_in_chain
|
||||
pub trait ChainOracle {
|
||||
@@ -21,5 +21,5 @@ pub trait ChainOracle {
|
||||
) -> Result<Option<bool>, Self::Error>;
|
||||
|
||||
/// Get the best chain's chain tip.
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error>;
|
||||
fn get_chain_tip(&self) -> Result<BlockId, Self::Error>;
|
||||
}
|
||||
|
||||
@@ -1,7 +1,5 @@
|
||||
//! Contains the [`IndexedTxGraph`] structure and associated types.
|
||||
//!
|
||||
//! This is essentially a [`TxGraph`] combined with an indexer.
|
||||
|
||||
//! Contains the [`IndexedTxGraph`] and associated types. Refer to the
|
||||
//! [`IndexedTxGraph`] documentation for more.
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{Block, OutPoint, Transaction, TxOut, Txid};
|
||||
|
||||
@@ -11,9 +9,9 @@ use crate::{
|
||||
Anchor, AnchorFromBlockPosition, Append, BlockId,
|
||||
};
|
||||
|
||||
/// A struct that combines [`TxGraph`] and an [`Indexer`] implementation.
|
||||
/// The [`IndexedTxGraph`] combines a [`TxGraph`] and an [`Indexer`] implementation.
|
||||
///
|
||||
/// This structure ensures that [`TxGraph`] and [`Indexer`] are updated atomically.
|
||||
/// It ensures that [`TxGraph`] and [`Indexer`] are updated atomically.
|
||||
#[derive(Debug)]
|
||||
pub struct IndexedTxGraph<A, I> {
|
||||
/// Transaction index.
|
||||
@@ -160,7 +158,7 @@ where
|
||||
/// Batch insert unconfirmed transactions, filtering out those that are irrelevant.
|
||||
///
|
||||
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||
/// Irrelevant tansactions in `txs` will be ignored.
|
||||
/// Irrelevant transactions in `txs` will be ignored.
|
||||
///
|
||||
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||
@@ -223,7 +221,7 @@ where
|
||||
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||
///
|
||||
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||
/// Irrelevant tansactions in `txs` will be ignored.
|
||||
/// Irrelevant transactions in `txs` will be ignored.
|
||||
pub fn apply_block_relevant(
|
||||
&mut self,
|
||||
block: Block,
|
||||
@@ -266,7 +264,7 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that represents changes to an [`IndexedTxGraph`].
|
||||
/// Represents changes to an [`IndexedTxGraph`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
|
||||
@@ -12,9 +12,8 @@
|
||||
//! you do it synchronously or asynchronously. If you know a fact about the blockchain, you can just
|
||||
//! tell `bdk_chain`'s APIs about it, and that information will be integrated, if it can be done
|
||||
//! consistently.
|
||||
//! 2. Error-free APIs.
|
||||
//! 3. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
||||
//! cache or how you fetch it.
|
||||
//! 2. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
||||
//! cache or how you retrieve it from persistent storage.
|
||||
//!
|
||||
//! [Bitcoin Dev Kit]: https://bitcoindevkit.org/
|
||||
|
||||
|
||||
@@ -7,7 +7,7 @@ use crate::{BlockId, ChainOracle};
|
||||
use alloc::sync::Arc;
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
/// A structure that represents changes to [`LocalChain`].
|
||||
/// The [`ChangeSet`] represents changes to [`LocalChain`].
|
||||
///
|
||||
/// The key represents the block height, and the value either represents added a new [`CheckPoint`]
|
||||
/// (if [`Some`]), or removing a [`CheckPoint`] (if [`None`]).
|
||||
@@ -127,7 +127,7 @@ impl CheckPoint {
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that iterates over checkpoints backwards.
|
||||
/// Iterates over checkpoints backwards.
|
||||
pub struct CheckPointIter {
|
||||
current: Option<Arc<CPInner>>,
|
||||
}
|
||||
@@ -153,7 +153,7 @@ impl IntoIterator for CheckPoint {
|
||||
}
|
||||
}
|
||||
|
||||
/// A struct to update [`LocalChain`].
|
||||
/// Used to update [`LocalChain`].
|
||||
///
|
||||
/// This is used as input for [`LocalChain::apply_update`]. It contains the update's chain `tip` and
|
||||
/// a flag `introduce_older_blocks` which signals whether this update intends to introduce missing
|
||||
@@ -179,9 +179,9 @@ pub struct Update {
|
||||
}
|
||||
|
||||
/// This is a local implementation of [`ChainOracle`].
|
||||
#[derive(Debug, Default, Clone)]
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct LocalChain {
|
||||
tip: Option<CheckPoint>,
|
||||
tip: CheckPoint,
|
||||
index: BTreeMap<u32, BlockHash>,
|
||||
}
|
||||
|
||||
@@ -197,12 +197,6 @@ impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||
}
|
||||
}
|
||||
|
||||
impl From<BTreeMap<u32, BlockHash>> for LocalChain {
|
||||
fn from(value: BTreeMap<u32, BlockHash>) -> Self {
|
||||
Self::from_blocks(value)
|
||||
}
|
||||
}
|
||||
|
||||
impl ChainOracle for LocalChain {
|
||||
type Error = Infallible;
|
||||
|
||||
@@ -225,39 +219,71 @@ impl ChainOracle for LocalChain {
|
||||
)
|
||||
}
|
||||
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error> {
|
||||
Ok(self.tip.as_ref().map(|tip| tip.block_id()))
|
||||
fn get_chain_tip(&self) -> Result<BlockId, Self::Error> {
|
||||
Ok(self.tip.block_id())
|
||||
}
|
||||
}
|
||||
|
||||
impl LocalChain {
|
||||
/// Get the genesis hash.
|
||||
pub fn genesis_hash(&self) -> BlockHash {
|
||||
self.index.get(&0).copied().expect("must have genesis hash")
|
||||
}
|
||||
|
||||
/// Construct [`LocalChain`] from genesis `hash`.
|
||||
#[must_use]
|
||||
pub fn from_genesis_hash(hash: BlockHash) -> (Self, ChangeSet) {
|
||||
let height = 0;
|
||||
let chain = Self {
|
||||
tip: CheckPoint::new(BlockId { height, hash }),
|
||||
index: core::iter::once((height, hash)).collect(),
|
||||
};
|
||||
let changeset = chain.initial_changeset();
|
||||
(chain, changeset)
|
||||
}
|
||||
|
||||
/// Construct a [`LocalChain`] from an initial `changeset`.
|
||||
pub fn from_changeset(changeset: ChangeSet) -> Self {
|
||||
let mut chain = Self::default();
|
||||
chain.apply_changeset(&changeset);
|
||||
pub fn from_changeset(changeset: ChangeSet) -> Result<Self, MissingGenesisError> {
|
||||
let genesis_entry = changeset.get(&0).copied().flatten();
|
||||
let genesis_hash = match genesis_entry {
|
||||
Some(hash) => hash,
|
||||
None => return Err(MissingGenesisError),
|
||||
};
|
||||
|
||||
let (mut chain, _) = Self::from_genesis_hash(genesis_hash);
|
||||
chain.apply_changeset(&changeset)?;
|
||||
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
debug_assert!(chain._check_changeset_is_applied(&changeset));
|
||||
|
||||
chain
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
/// Construct a [`LocalChain`] from a given `checkpoint` tip.
|
||||
pub fn from_tip(tip: CheckPoint) -> Self {
|
||||
pub fn from_tip(tip: CheckPoint) -> Result<Self, MissingGenesisError> {
|
||||
let mut chain = Self {
|
||||
tip: Some(tip),
|
||||
..Default::default()
|
||||
tip,
|
||||
index: BTreeMap::new(),
|
||||
};
|
||||
chain.reindex(0);
|
||||
|
||||
if chain.index.get(&0).copied().is_none() {
|
||||
return Err(MissingGenesisError);
|
||||
}
|
||||
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
chain
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
/// Constructs a [`LocalChain`] from a [`BTreeMap`] of height to [`BlockHash`].
|
||||
///
|
||||
/// The [`BTreeMap`] enforces the height order. However, the caller must ensure the blocks are
|
||||
/// all of the same chain.
|
||||
pub fn from_blocks(blocks: BTreeMap<u32, BlockHash>) -> Self {
|
||||
pub fn from_blocks(blocks: BTreeMap<u32, BlockHash>) -> Result<Self, MissingGenesisError> {
|
||||
if !blocks.contains_key(&0) {
|
||||
return Err(MissingGenesisError);
|
||||
}
|
||||
|
||||
let mut tip: Option<CheckPoint> = None;
|
||||
|
||||
for block in &blocks {
|
||||
@@ -272,25 +298,20 @@ impl LocalChain {
|
||||
}
|
||||
}
|
||||
|
||||
let chain = Self { index: blocks, tip };
|
||||
let chain = Self {
|
||||
index: blocks,
|
||||
tip: tip.expect("already checked to have genesis"),
|
||||
};
|
||||
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
|
||||
chain
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
/// Get the highest checkpoint.
|
||||
pub fn tip(&self) -> Option<CheckPoint> {
|
||||
pub fn tip(&self) -> CheckPoint {
|
||||
self.tip.clone()
|
||||
}
|
||||
|
||||
/// Returns whether the [`LocalChain`] is empty (has no checkpoints).
|
||||
pub fn is_empty(&self) -> bool {
|
||||
let res = self.tip.is_none();
|
||||
debug_assert_eq!(res, self.index.is_empty());
|
||||
res
|
||||
}
|
||||
|
||||
/// Applies the given `update` to the chain.
|
||||
///
|
||||
/// The method returns [`ChangeSet`] on success. This represents the applied changes to `self`.
|
||||
@@ -312,34 +333,28 @@ impl LocalChain {
|
||||
///
|
||||
/// [module-level documentation]: crate::local_chain
|
||||
pub fn apply_update(&mut self, update: Update) -> Result<ChangeSet, CannotConnectError> {
|
||||
match self.tip() {
|
||||
Some(original_tip) => {
|
||||
let changeset = merge_chains(
|
||||
original_tip,
|
||||
update.tip.clone(),
|
||||
update.introduce_older_blocks,
|
||||
)?;
|
||||
self.apply_changeset(&changeset);
|
||||
|
||||
// return early as `apply_changeset` already calls `check_consistency`
|
||||
Ok(changeset)
|
||||
}
|
||||
None => {
|
||||
*self = Self::from_tip(update.tip);
|
||||
let changeset = self.initial_changeset();
|
||||
|
||||
debug_assert!(self._check_index_is_consistent_with_tip());
|
||||
debug_assert!(self._check_changeset_is_applied(&changeset));
|
||||
Ok(changeset)
|
||||
}
|
||||
}
|
||||
let changeset = merge_chains(
|
||||
self.tip.clone(),
|
||||
update.tip.clone(),
|
||||
update.introduce_older_blocks,
|
||||
)?;
|
||||
// `._check_index_is_consistent_with_tip` and `._check_changeset_is_applied` is called in
|
||||
// `.apply_changeset`
|
||||
self.apply_changeset(&changeset)
|
||||
.map_err(|_| CannotConnectError {
|
||||
try_include_height: 0,
|
||||
})?;
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Apply the given `changeset`.
|
||||
pub fn apply_changeset(&mut self, changeset: &ChangeSet) {
|
||||
pub fn apply_changeset(&mut self, changeset: &ChangeSet) -> Result<(), MissingGenesisError> {
|
||||
if let Some(start_height) = changeset.keys().next().cloned() {
|
||||
// changes after point of agreement
|
||||
let mut extension = BTreeMap::default();
|
||||
// point of agreement
|
||||
let mut base: Option<CheckPoint> = None;
|
||||
|
||||
for cp in self.iter_checkpoints() {
|
||||
if cp.height() >= start_height {
|
||||
extension.insert(cp.height(), cp.hash());
|
||||
@@ -359,12 +374,12 @@ impl LocalChain {
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
let new_tip = match base {
|
||||
Some(base) => Some(
|
||||
base.extend(extension.into_iter().map(BlockId::from))
|
||||
.expect("extension is strictly greater than base"),
|
||||
),
|
||||
None => LocalChain::from_blocks(extension).tip(),
|
||||
Some(base) => base
|
||||
.extend(extension.into_iter().map(BlockId::from))
|
||||
.expect("extension is strictly greater than base"),
|
||||
None => LocalChain::from_blocks(extension)?.tip(),
|
||||
};
|
||||
self.tip = new_tip;
|
||||
self.reindex(start_height);
|
||||
@@ -372,6 +387,8 @@ impl LocalChain {
|
||||
debug_assert!(self._check_index_is_consistent_with_tip());
|
||||
debug_assert!(self._check_changeset_is_applied(changeset));
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Insert a [`BlockId`].
|
||||
@@ -379,13 +396,13 @@ impl LocalChain {
|
||||
/// # Errors
|
||||
///
|
||||
/// Replacing the block hash of an existing checkpoint will result in an error.
|
||||
pub fn insert_block(&mut self, block_id: BlockId) -> Result<ChangeSet, InsertBlockError> {
|
||||
pub fn insert_block(&mut self, block_id: BlockId) -> Result<ChangeSet, AlterCheckPointError> {
|
||||
if let Some(&original_hash) = self.index.get(&block_id.height) {
|
||||
if original_hash != block_id.hash {
|
||||
return Err(InsertBlockError {
|
||||
return Err(AlterCheckPointError {
|
||||
height: block_id.height,
|
||||
original_hash,
|
||||
update_hash: block_id.hash,
|
||||
update_hash: Some(block_id.hash),
|
||||
});
|
||||
} else {
|
||||
return Ok(ChangeSet::default());
|
||||
@@ -394,7 +411,12 @@ impl LocalChain {
|
||||
|
||||
let mut changeset = ChangeSet::default();
|
||||
changeset.insert(block_id.height, Some(block_id.hash));
|
||||
self.apply_changeset(&changeset);
|
||||
self.apply_changeset(&changeset)
|
||||
.map_err(|_| AlterCheckPointError {
|
||||
height: 0,
|
||||
original_hash: self.genesis_hash(),
|
||||
update_hash: changeset.get(&0).cloned().flatten(),
|
||||
})?;
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
@@ -418,7 +440,7 @@ impl LocalChain {
|
||||
/// Iterate over checkpoints in descending height order.
|
||||
pub fn iter_checkpoints(&self) -> CheckPointIter {
|
||||
CheckPointIter {
|
||||
current: self.tip.as_ref().map(|tip| tip.0.clone()),
|
||||
current: Some(self.tip.0.clone()),
|
||||
}
|
||||
}
|
||||
|
||||
@@ -431,7 +453,6 @@ impl LocalChain {
|
||||
let tip_history = self
|
||||
.tip
|
||||
.iter()
|
||||
.flat_map(CheckPoint::iter)
|
||||
.map(|cp| (cp.height(), cp.hash()))
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
self.index == tip_history
|
||||
@@ -447,29 +468,52 @@ impl LocalChain {
|
||||
}
|
||||
}
|
||||
|
||||
/// Represents a failure when trying to insert a checkpoint into [`LocalChain`].
|
||||
/// An error which occurs when a [`LocalChain`] is constructed without a genesis checkpoint.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct InsertBlockError {
|
||||
/// The checkpoints' height.
|
||||
pub height: u32,
|
||||
/// Original checkpoint's block hash.
|
||||
pub original_hash: BlockHash,
|
||||
/// Update checkpoint's block hash.
|
||||
pub update_hash: BlockHash,
|
||||
}
|
||||
pub struct MissingGenesisError;
|
||||
|
||||
impl core::fmt::Display for InsertBlockError {
|
||||
impl core::fmt::Display for MissingGenesisError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"failed to insert block at height {} as block hashes conflict: original={}, update={}",
|
||||
self.height, self.original_hash, self.update_hash
|
||||
"cannot construct `LocalChain` without a genesis checkpoint"
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for InsertBlockError {}
|
||||
impl std::error::Error for MissingGenesisError {}
|
||||
|
||||
/// Represents a failure when trying to insert/remove a checkpoint to/from [`LocalChain`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct AlterCheckPointError {
|
||||
/// The checkpoint's height.
|
||||
pub height: u32,
|
||||
/// The original checkpoint's block hash which cannot be replaced/removed.
|
||||
pub original_hash: BlockHash,
|
||||
/// The attempted update to the `original_block` hash.
|
||||
pub update_hash: Option<BlockHash>,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for AlterCheckPointError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self.update_hash {
|
||||
Some(update_hash) => write!(
|
||||
f,
|
||||
"failed to insert block at height {}: original={} update={}",
|
||||
self.height, self.original_hash, update_hash
|
||||
),
|
||||
None => write!(
|
||||
f,
|
||||
"failed to remove block at height {}: original={}",
|
||||
self.height, self.original_hash
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AlterCheckPointError {}
|
||||
|
||||
/// Occurs when an update does not have a common checkpoint with the original chain.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
|
||||
@@ -79,10 +79,10 @@ pub trait PersistBackend<C> {
|
||||
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError>;
|
||||
|
||||
/// Return the aggregate changeset `C` from persistence.
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError>;
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError>;
|
||||
}
|
||||
|
||||
impl<C: Default> PersistBackend<C> for () {
|
||||
impl<C> PersistBackend<C> for () {
|
||||
type WriteError = Infallible;
|
||||
|
||||
type LoadError = Infallible;
|
||||
@@ -91,7 +91,7 @@ impl<C: Default> PersistBackend<C> for () {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
Ok(C::default())
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -5,21 +5,25 @@ use alloc::vec::Vec;
|
||||
|
||||
/// Trait that "anchors" blockchain data to a specific block of height and hash.
|
||||
///
|
||||
/// [`Anchor`] implementations must be [`Ord`] by the anchor block's [`BlockId`] first.
|
||||
///
|
||||
/// I.e. If transaction A is anchored in block B, then if block B is in the best chain, we can
|
||||
/// If transaction A is anchored in block B, and block B is in the best chain, we can
|
||||
/// assume that transaction A is also confirmed in the best chain. This does not necessarily mean
|
||||
/// that transaction A is confirmed in block B. It could also mean transaction A is confirmed in a
|
||||
/// parent block of B.
|
||||
///
|
||||
/// Every [`Anchor`] implementation must contain a [`BlockId`] parameter, and must implement
|
||||
/// [`Ord`]. When implementing [`Ord`], the anchors' [`BlockId`]s should take precedence
|
||||
/// over other elements inside the [`Anchor`]s for comparison purposes, i.e., you should first
|
||||
/// compare the anchors' [`BlockId`]s and then care about the rest.
|
||||
///
|
||||
/// The example shows different types of anchors:
|
||||
/// ```
|
||||
/// # use bdk_chain::local_chain::LocalChain;
|
||||
/// # use bdk_chain::tx_graph::TxGraph;
|
||||
/// # use bdk_chain::BlockId;
|
||||
/// # use bdk_chain::ConfirmationHeightAnchor;
|
||||
/// # use bdk_chain::ConfirmationTimeHeightAnchor;
|
||||
/// # use bdk_chain::example_utils::*;
|
||||
/// # use bitcoin::hashes::Hash;
|
||||
///
|
||||
/// // Initialize the local chain with two blocks.
|
||||
/// let chain = LocalChain::from_blocks(
|
||||
/// [
|
||||
@@ -47,6 +51,7 @@ use alloc::vec::Vec;
|
||||
/// );
|
||||
///
|
||||
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationHeightAnchor` as the anchor type.
|
||||
/// // This anchor records the anchor block and the confirmation height of the transaction.
|
||||
/// // When a transaction is anchored with `ConfirmationHeightAnchor`, the anchor block and
|
||||
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||
@@ -62,6 +67,25 @@ use alloc::vec::Vec;
|
||||
/// confirmation_height: 1,
|
||||
/// },
|
||||
/// );
|
||||
///
|
||||
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationTimeHeightAnchor` as the anchor type.
|
||||
/// // This anchor records the anchor block, the confirmation height and time of the transaction.
|
||||
/// // When a transaction is anchored with `ConfirmationTimeHeightAnchor`, the anchor block and
|
||||
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||
/// let mut graph_c = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||
/// let _ = graph_c.insert_tx(tx.clone());
|
||||
/// graph_c.insert_anchor(
|
||||
/// tx.txid(),
|
||||
/// ConfirmationTimeHeightAnchor {
|
||||
/// anchor_block: BlockId {
|
||||
/// height: 2,
|
||||
/// hash: Hash::hash("third".as_bytes()),
|
||||
/// },
|
||||
/// confirmation_height: 1,
|
||||
/// confirmation_time: 123,
|
||||
/// },
|
||||
/// );
|
||||
/// ```
|
||||
pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash::Hash {
|
||||
/// Returns the [`BlockId`] that the associated blockchain data is "anchored" in.
|
||||
|
||||
@@ -1,12 +1,32 @@
|
||||
//! Module for structures that store and traverse transactions.
|
||||
//!
|
||||
//! [`TxGraph`] is a monotone structure that inserts transactions and indexes the spends. The
|
||||
//! [`ChangeSet`] structure reports changes of [`TxGraph`] but can also be applied to a
|
||||
//! [`TxGraph`] as well. Lastly, [`TxDescendants`] is an [`Iterator`] that traverses descendants of
|
||||
//! a given transaction.
|
||||
//! [`TxGraph`] contains transactions and indexes them so you can easily traverse the graph of those transactions.
|
||||
//! `TxGraph` is *monotone* in that you can always insert a transaction -- it doesn't care whether that
|
||||
//! transaction is in the current best chain or whether it conflicts with any of the
|
||||
//! existing transactions or what order you insert the transactions. This means that you can always
|
||||
//! combine two [`TxGraph`]s together, without resulting in inconsistencies.
|
||||
//! Furthermore, there is currently no way to delete a transaction.
|
||||
//!
|
||||
//! Transactions can be either whole or partial (i.e., transactions for which we only
|
||||
//! know some outputs, which we usually call "floating outputs"; these are usually inserted
|
||||
//! using the [`insert_txout`] method.).
|
||||
//!
|
||||
//! The graph contains transactions in the form of [`TxNode`]s. Each node contains the
|
||||
//! txid, the transaction (whole or partial), the blocks it's anchored in (see the [`Anchor`]
|
||||
//! documentation for more details), and the timestamp of the last time we saw
|
||||
//! the transaction as unconfirmed.
|
||||
//!
|
||||
//! Conflicting transactions are allowed to coexist within a [`TxGraph`]. This is useful for
|
||||
//! identifying and traversing conflicts and descendants of a given transaction.
|
||||
//! identifying and traversing conflicts and descendants of a given transaction. Some [`TxGraph`]
|
||||
//! methods only consider "canonical" (i.e., in the best chain or in mempool) transactions,
|
||||
//! we decide which transactions are canonical based on anchors `last_seen_unconfirmed`;
|
||||
//! see the [`try_get_chain_position`] documentation for more details.
|
||||
//!
|
||||
//! The [`ChangeSet`] reports changes made to a [`TxGraph`]; it can be used to either save to
|
||||
//! persistent storage, or to be applied to another [`TxGraph`].
|
||||
//!
|
||||
//! Lastly, you can use [`TxAncestors`]/[`TxDescendants`] to traverse ancestors and descendants of
|
||||
//! a given transaction, respectively.
|
||||
//!
|
||||
//! # Applying changes
|
||||
//!
|
||||
@@ -49,6 +69,8 @@
|
||||
//! let changeset = graph.apply_update(update);
|
||||
//! assert!(changeset.is_empty());
|
||||
//! ```
|
||||
//! [`try_get_chain_position`]: TxGraph::try_get_chain_position
|
||||
//! [`insert_txout`]: TxGraph::insert_txout
|
||||
|
||||
use crate::{
|
||||
collections::*, keychain::Balance, local_chain::LocalChain, Anchor, Append, BlockId,
|
||||
@@ -57,6 +79,7 @@ use crate::{
|
||||
use alloc::collections::vec_deque::VecDeque;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
||||
use core::fmt::{self, Formatter};
|
||||
use core::{
|
||||
convert::Infallible,
|
||||
ops::{Deref, RangeInclusive},
|
||||
@@ -90,7 +113,7 @@ impl<A> Default for TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
/// An outward-facing view of a (transaction) node in the [`TxGraph`].
|
||||
/// A transaction node in the [`TxGraph`].
|
||||
#[derive(Clone, Debug, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct TxNode<'a, T, A> {
|
||||
/// Txid of the transaction.
|
||||
@@ -127,7 +150,7 @@ impl Default for TxNodeInternal {
|
||||
}
|
||||
}
|
||||
|
||||
/// An outwards-facing view of a transaction that is part of the *best chain*'s history.
|
||||
/// A transaction that is included in the chain, or is still in mempool.
|
||||
#[derive(Clone, Debug, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct CanonicalTx<'a, T, A> {
|
||||
/// How the transaction is observed as (confirmed or unconfirmed).
|
||||
@@ -145,6 +168,26 @@ pub enum CalculateFeeError {
|
||||
NegativeFee(i64),
|
||||
}
|
||||
|
||||
impl fmt::Display for CalculateFeeError {
|
||||
fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
CalculateFeeError::MissingTxOut(outpoints) => write!(
|
||||
f,
|
||||
"missing `TxOut` for one or more of the inputs of the tx: {:?}",
|
||||
outpoints
|
||||
),
|
||||
CalculateFeeError::NegativeFee(fee) => write!(
|
||||
f,
|
||||
"transaction is invalid according to the graph and has negative fee: {}",
|
||||
fee
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for CalculateFeeError {}
|
||||
|
||||
impl<A> TxGraph<A> {
|
||||
/// Iterate over all tx outputs known by [`TxGraph`].
|
||||
///
|
||||
@@ -454,7 +497,7 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
/// Batch insert unconfirmed transactions.
|
||||
///
|
||||
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||
/// *last seen* communicates when the transaction is last seen in mempool which is used for
|
||||
/// conflict-resolution (refer to [`TxGraph::insert_seen_at`] for details).
|
||||
pub fn batch_insert_unconfirmed(
|
||||
&mut self,
|
||||
@@ -480,7 +523,7 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
|
||||
/// Inserts the given `seen_at` for `txid` into [`TxGraph`].
|
||||
///
|
||||
/// Note that [`TxGraph`] only keeps track of the lastest `seen_at`.
|
||||
/// Note that [`TxGraph`] only keeps track of the latest `seen_at`.
|
||||
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> ChangeSet<A> {
|
||||
let mut update = Self::default();
|
||||
let (_, _, update_last_seen) = update.txs.entry(txid).or_default();
|
||||
@@ -687,8 +730,20 @@ impl<A: Anchor> TxGraph<A> {
|
||||
|
||||
/// Get the position of the transaction in `chain` with tip `chain_tip`.
|
||||
///
|
||||
/// If the given transaction of `txid` does not exist in the chain of `chain_tip`, `None` is
|
||||
/// returned.
|
||||
/// Chain data is fetched from `chain`, a [`ChainOracle`] implementation.
|
||||
///
|
||||
/// This method returns `Ok(None)` if the transaction is not found in the chain, and no longer
|
||||
/// belongs in the mempool. The following factors are used to approximate whether an
|
||||
/// unconfirmed transaction exists in the mempool (not evicted):
|
||||
///
|
||||
/// 1. Unconfirmed transactions that conflict with confirmed transactions are evicted.
|
||||
/// 2. Unconfirmed transactions that spend from transactions that are evicted, are also
|
||||
/// evicted.
|
||||
/// 3. Given two conflicting unconfirmed transactions, the transaction with the lower
|
||||
/// `last_seen_unconfirmed` parameter is evicted. A transaction's `last_seen_unconfirmed`
|
||||
/// parameter is the max of all it's descendants' `last_seen_unconfirmed` parameters. If the
|
||||
/// final `last_seen_unconfirmed`s are the same, the transaction with the lower `txid` (by
|
||||
/// lexicographical order) is evicted.
|
||||
///
|
||||
/// # Error
|
||||
///
|
||||
@@ -714,11 +769,18 @@ impl<A: Anchor> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
// The tx is not anchored to a block which is in the best chain, which means that it
|
||||
// The tx is not anchored to a block in the best chain, which means that it
|
||||
// might be in mempool, or it might have been dropped already.
|
||||
// Let's check conflicts to find out!
|
||||
let tx = match tx_node {
|
||||
TxNodeInternal::Whole(tx) => tx,
|
||||
TxNodeInternal::Whole(tx) => {
|
||||
// A coinbase tx that is not anchored in the best chain cannot be unconfirmed and
|
||||
// should always be filtered out.
|
||||
if tx.is_coin_base() {
|
||||
return Ok(None);
|
||||
}
|
||||
tx
|
||||
}
|
||||
TxNodeInternal::Partial(_) => {
|
||||
// Partial transactions (outputs only) cannot have conflicts.
|
||||
return Ok(None);
|
||||
@@ -789,6 +851,12 @@ impl<A: Anchor> TxGraph<A> {
|
||||
if conflicting_tx.last_seen_unconfirmed > tx_last_seen {
|
||||
return Ok(None);
|
||||
}
|
||||
if conflicting_tx.last_seen_unconfirmed == *last_seen
|
||||
&& conflicting_tx.txid() > tx.txid()
|
||||
{
|
||||
// Conflicting tx has priority if txid of conflicting tx > txid of original tx
|
||||
return Ok(None);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -911,7 +979,8 @@ impl<A: Anchor> TxGraph<A> {
|
||||
/// (`OI`) for convenience. If `OI` is not necessary, the caller can use `()`, or
|
||||
/// [`Iterator::enumerate`] over a list of [`OutPoint`]s.
|
||||
///
|
||||
/// Floating outputs are ignored.
|
||||
/// Floating outputs (i.e., outputs for which we don't have the full transaction in the graph)
|
||||
/// are ignored.
|
||||
///
|
||||
/// # Error
|
||||
///
|
||||
@@ -1102,9 +1171,9 @@ impl<A: Anchor> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that represents changes to a [`TxGraph`].
|
||||
/// The [`ChangeSet`] represents changes to a [`TxGraph`].
|
||||
///
|
||||
/// Since [`TxGraph`] is monotone "changeset" can only contain transactions to be added and
|
||||
/// Since [`TxGraph`] is monotone, the "changeset" can only contain transactions to be added and
|
||||
/// not removed.
|
||||
///
|
||||
/// Refer to [module-level documentation] for more.
|
||||
@@ -1238,7 +1307,7 @@ impl<A> AsRef<TxGraph<A>> for TxGraph<A> {
|
||||
///
|
||||
/// The iterator excludes partial transactions.
|
||||
///
|
||||
/// This `struct` is created by the [`walk_ancestors`] method of [`TxGraph`].
|
||||
/// Returned by the [`walk_ancestors`] method of [`TxGraph`].
|
||||
///
|
||||
/// [`walk_ancestors`]: TxGraph::walk_ancestors
|
||||
pub struct TxAncestors<'g, A, F> {
|
||||
@@ -1356,7 +1425,7 @@ where
|
||||
|
||||
/// An iterator that traverses transaction descendants.
|
||||
///
|
||||
/// This `struct` is created by the [`walk_descendants`] method of [`TxGraph`].
|
||||
/// Returned by the [`walk_descendants`] method of [`TxGraph`].
|
||||
///
|
||||
/// [`walk_descendants`]: TxGraph::walk_descendants
|
||||
pub struct TxDescendants<'g, A, F> {
|
||||
|
||||
@@ -23,6 +23,7 @@ macro_rules! local_chain {
|
||||
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||
#[allow(unused_mut)]
|
||||
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||
.expect("chain must have genesis block")
|
||||
}};
|
||||
}
|
||||
|
||||
@@ -32,8 +33,8 @@ macro_rules! chain_update {
|
||||
#[allow(unused_mut)]
|
||||
bdk_chain::local_chain::Update {
|
||||
tip: bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $hash).into()),*].into_iter().collect())
|
||||
.tip()
|
||||
.expect("must have tip"),
|
||||
.expect("chain must have genesis block")
|
||||
.tip(),
|
||||
introduce_older_blocks: true,
|
||||
}
|
||||
}};
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
use std::collections::{BTreeMap, BTreeSet};
|
||||
use std::collections::BTreeSet;
|
||||
|
||||
use bdk_chain::{
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
@@ -9,9 +9,7 @@ use bdk_chain::{
|
||||
local_chain::LocalChain,
|
||||
tx_graph, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bitcoin::{
|
||||
secp256k1::Secp256k1, BlockHash, OutPoint, Script, ScriptBuf, Transaction, TxIn, TxOut,
|
||||
};
|
||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, ScriptBuf, Transaction, TxIn, TxOut};
|
||||
use miniscript::Descriptor;
|
||||
|
||||
/// Ensure [`IndexedTxGraph::insert_relevant_txs`] can successfully index transactions NOT presented
|
||||
@@ -112,11 +110,8 @@ fn insert_relevant_txs() {
|
||||
|
||||
fn test_list_owned_txouts() {
|
||||
// Create Local chains
|
||||
let local_chain = LocalChain::from(
|
||||
(0..150)
|
||||
.map(|i| (i as u32, h!("random")))
|
||||
.collect::<BTreeMap<u32, BlockHash>>(),
|
||||
);
|
||||
let local_chain = LocalChain::from_blocks((0..150).map(|i| (i as u32, h!("random"))).collect())
|
||||
.expect("must have genesis hash");
|
||||
|
||||
// Initiate IndexedTxGraph
|
||||
|
||||
|
||||
@@ -312,7 +312,7 @@ fn test_wildcard_derivations() {
|
||||
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
||||
|
||||
(0..=15)
|
||||
.chain(vec![17, 20, 23].into_iter())
|
||||
.chain([17, 20, 23])
|
||||
.for_each(|index| assert!(txout_index.mark_used(&TestKeychain::External, index)));
|
||||
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
||||
|
||||
@@ -1,4 +1,6 @@
|
||||
use bdk_chain::local_chain::{CannotConnectError, ChangeSet, InsertBlockError, LocalChain, Update};
|
||||
use bdk_chain::local_chain::{
|
||||
AlterCheckPointError, CannotConnectError, ChangeSet, LocalChain, Update,
|
||||
};
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
#[macro_use]
|
||||
@@ -68,10 +70,10 @@ fn update_local_chain() {
|
||||
[
|
||||
TestLocalChain {
|
||||
name: "add first tip",
|
||||
chain: local_chain![],
|
||||
chain: local_chain![(0, h!("A"))],
|
||||
update: chain_update![(0, h!("A"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(0, Some(h!("A")))],
|
||||
changeset: &[],
|
||||
init_changeset: &[(0, Some(h!("A")))],
|
||||
},
|
||||
},
|
||||
@@ -86,18 +88,18 @@ fn update_local_chain() {
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "two disjoint chains cannot merge",
|
||||
chain: local_chain![(0, h!("A"))],
|
||||
update: chain_update![(1, h!("B"))],
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 0,
|
||||
try_include_height: 1,
|
||||
}),
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "two disjoint chains cannot merge (existing chain longer)",
|
||||
chain: local_chain![(1, h!("A"))],
|
||||
update: chain_update![(0, h!("B"))],
|
||||
chain: local_chain![(0, h!("_")), (2, h!("A"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 1,
|
||||
try_include_height: 2,
|
||||
}),
|
||||
},
|
||||
TestLocalChain {
|
||||
@@ -111,54 +113,54 @@ fn update_local_chain() {
|
||||
},
|
||||
// Introduce an older checkpoint (B)
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | C D
|
||||
// update | B C
|
||||
// chain | _ C D
|
||||
// update | _ B C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint",
|
||||
chain: local_chain![(2, h!("C")), (3, h!("D"))],
|
||||
update: chain_update![(1, h!("B")), (2, h!("C"))],
|
||||
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B")), (2, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("B")))],
|
||||
init_changeset: &[(1, Some(h!("B"))), (2, Some(h!("C"))), (3, Some(h!("D")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("B"))), (2, Some(h!("C"))), (3, Some(h!("D")))],
|
||||
},
|
||||
},
|
||||
// Introduce an older checkpoint (A) that is not directly behind PoA
|
||||
// | 2 | 3 | 4
|
||||
// chain | B C
|
||||
// update | A C
|
||||
// | 0 | 2 | 3 | 4
|
||||
// chain | _ B C
|
||||
// update | _ A C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint 2",
|
||||
chain: local_chain![(3, h!("B")), (4, h!("C"))],
|
||||
update: chain_update![(2, h!("A")), (4, h!("C"))],
|
||||
chain: local_chain![(0, h!("_")), (3, h!("B")), (4, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("A")), (4, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(2, Some(h!("A")))],
|
||||
init_changeset: &[(2, Some(h!("A"))), (3, Some(h!("B"))), (4, Some(h!("C")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (2, Some(h!("A"))), (3, Some(h!("B"))), (4, Some(h!("C")))],
|
||||
}
|
||||
},
|
||||
// Introduce an older checkpoint (B) that is not the oldest checkpoint
|
||||
// | 1 | 2 | 3
|
||||
// chain | A C
|
||||
// update | B C
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | _ A C
|
||||
// update | _ B C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint 3",
|
||||
chain: local_chain![(1, h!("A")), (3, h!("C"))],
|
||||
update: chain_update![(2, h!("B")), (3, h!("C"))],
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(2, Some(h!("B")))],
|
||||
init_changeset: &[(1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
}
|
||||
},
|
||||
// Introduce two older checkpoints below the PoA
|
||||
// | 1 | 2 | 3
|
||||
// chain | C
|
||||
// update | A B C
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | _ C
|
||||
// update | _ A B C
|
||||
TestLocalChain {
|
||||
name: "introduce two older checkpoints below PoA",
|
||||
chain: local_chain![(3, h!("C"))],
|
||||
update: chain_update![(1, h!("A")), (2, h!("B")), (3, h!("C"))],
|
||||
chain: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("A"))), (2, Some(h!("B")))],
|
||||
init_changeset: &[(1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
},
|
||||
},
|
||||
TestLocalChain {
|
||||
@@ -172,45 +174,46 @@ fn update_local_chain() {
|
||||
},
|
||||
// B and C are in both chain and update
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | B C
|
||||
// update | A B C D
|
||||
// chain | _ B C
|
||||
// update | _ A B C D
|
||||
// This should succeed with the point of agreement being C and A should be added in addition.
|
||||
TestLocalChain {
|
||||
name: "two points of agreement",
|
||||
chain: local_chain![(1, h!("B")), (2, h!("C"))],
|
||||
update: chain_update![(0, h!("A")), (1, h!("B")), (2, h!("C")), (3, h!("D"))],
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(0, Some(h!("A"))), (3, Some(h!("D")))],
|
||||
changeset: &[(1, Some(h!("A"))), (4, Some(h!("D")))],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("A"))),
|
||||
(1, Some(h!("B"))),
|
||||
(2, Some(h!("C"))),
|
||||
(3, Some(h!("D"))),
|
||||
(0, Some(h!("_"))),
|
||||
(1, Some(h!("A"))),
|
||||
(2, Some(h!("B"))),
|
||||
(3, Some(h!("C"))),
|
||||
(4, Some(h!("D"))),
|
||||
],
|
||||
},
|
||||
},
|
||||
// Update and chain does not connect:
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | B C
|
||||
// update | A B D
|
||||
// chain | _ B C
|
||||
// update | _ A B D
|
||||
// This should fail as we cannot figure out whether C & D are on the same chain
|
||||
TestLocalChain {
|
||||
name: "update and chain does not connect",
|
||||
chain: local_chain![(1, h!("B")), (2, h!("C"))],
|
||||
update: chain_update![(0, h!("A")), (1, h!("B")), (3, h!("D"))],
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 2,
|
||||
try_include_height: 3,
|
||||
}),
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
// chain | A B C E
|
||||
// update | A B' C' D
|
||||
// chain | _ B C E
|
||||
// update | _ B' C' D
|
||||
// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||
TestLocalChain {
|
||||
name: "transitive invalidation applies to checkpoints higher than invalidation",
|
||||
chain: local_chain![(0, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||
update: chain_update![(0, h!("A")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[
|
||||
(2, Some(h!("B'"))),
|
||||
@@ -219,7 +222,7 @@ fn update_local_chain() {
|
||||
(5, None),
|
||||
],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("A"))),
|
||||
(0, Some(h!("_"))),
|
||||
(2, Some(h!("B'"))),
|
||||
(3, Some(h!("C'"))),
|
||||
(4, Some(h!("D"))),
|
||||
@@ -228,13 +231,13 @@ fn update_local_chain() {
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | B C E
|
||||
// update | B' C' D
|
||||
// chain | _ B C E
|
||||
// update | _ B' C' D
|
||||
// This should succeed and invalidate B, C and E with no point of agreement
|
||||
TestLocalChain {
|
||||
name: "transitive invalidation applies to checkpoints higher than invalidation no point of agreement",
|
||||
chain: local_chain![(1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||
update: chain_update![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||
chain: local_chain![(0, h!("_")), (1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[
|
||||
(1, Some(h!("B'"))),
|
||||
@@ -243,6 +246,7 @@ fn update_local_chain() {
|
||||
(4, None)
|
||||
],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("_"))),
|
||||
(1, Some(h!("B'"))),
|
||||
(2, Some(h!("C'"))),
|
||||
(3, Some(h!("D"))),
|
||||
@@ -250,16 +254,16 @@ fn update_local_chain() {
|
||||
},
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | A B C E
|
||||
// update | B' C' D
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
// chain | _ A B C E
|
||||
// update | _ B' C' D
|
||||
// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||
// A was invalid.
|
||||
TestLocalChain {
|
||||
name: "invalidation but no connection",
|
||||
chain: local_chain![(0, h!("A")), (1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||
update: chain_update![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError { try_include_height: 0 }),
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError { try_include_height: 1 }),
|
||||
},
|
||||
// Introduce blocks between two points of agreement
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
@@ -294,44 +298,44 @@ fn local_chain_insert_block() {
|
||||
struct TestCase {
|
||||
original: LocalChain,
|
||||
insert: (u32, BlockHash),
|
||||
expected_result: Result<ChangeSet, InsertBlockError>,
|
||||
expected_result: Result<ChangeSet, AlterCheckPointError>,
|
||||
expected_final: LocalChain,
|
||||
}
|
||||
|
||||
let test_cases = [
|
||||
TestCase {
|
||||
original: local_chain![],
|
||||
original: local_chain![(0, h!("_"))],
|
||||
insert: (5, h!("block5")),
|
||||
expected_result: Ok([(5, Some(h!("block5")))].into()),
|
||||
expected_final: local_chain![(5, h!("block5"))],
|
||||
expected_final: local_chain![(0, h!("_")), (5, h!("block5"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(3, h!("A"))],
|
||||
original: local_chain![(0, h!("_")), (3, h!("A"))],
|
||||
insert: (4, h!("B")),
|
||||
expected_result: Ok([(4, Some(h!("B")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(4, h!("B"))],
|
||||
original: local_chain![(0, h!("_")), (4, h!("B"))],
|
||||
insert: (3, h!("A")),
|
||||
expected_result: Ok([(3, Some(h!("A")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
insert: (2, h!("K")),
|
||||
expected_result: Ok([].into()),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
insert: (2, h!("J")),
|
||||
expected_result: Err(InsertBlockError {
|
||||
expected_result: Err(AlterCheckPointError {
|
||||
height: 2,
|
||||
original_hash: h!("K"),
|
||||
update_hash: h!("J"),
|
||||
update_hash: Some(h!("J")),
|
||||
}),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
},
|
||||
];
|
||||
|
||||
|
||||
@@ -15,7 +15,7 @@ use std::vec;
|
||||
|
||||
#[test]
|
||||
fn insert_txouts() {
|
||||
// 2 (Outpoint, TxOut) tupples that denotes original data in the graph, as partial transactions.
|
||||
// 2 (Outpoint, TxOut) tuples that denotes original data in the graph, as partial transactions.
|
||||
let original_ops = [
|
||||
(
|
||||
OutPoint::new(h!("tx1"), 1),
|
||||
@@ -33,7 +33,7 @@ fn insert_txouts() {
|
||||
),
|
||||
];
|
||||
|
||||
// Another (OutPoint, TxOut) tupple to be used as update as partial transaction.
|
||||
// Another (OutPoint, TxOut) tuple to be used as update as partial transaction.
|
||||
let update_ops = [(
|
||||
OutPoint::new(h!("tx2"), 0),
|
||||
TxOut {
|
||||
@@ -511,11 +511,13 @@ fn test_calculate_fee_on_coinbase() {
|
||||
// where b0 and b1 spend a0, c0 and c1 spend b0, d0 spends c1, etc.
|
||||
#[test]
|
||||
fn test_walk_ancestors() {
|
||||
let local_chain: LocalChain = (0..=20)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect::<BTreeMap<u32, BlockHash>>()
|
||||
.into();
|
||||
let tip = local_chain.tip().expect("must have tip");
|
||||
let local_chain = LocalChain::from_blocks(
|
||||
(0..=20)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect(),
|
||||
)
|
||||
.expect("must contain genesis hash");
|
||||
let tip = local_chain.tip();
|
||||
|
||||
let tx_a0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
@@ -839,11 +841,13 @@ fn test_descendants_no_repeat() {
|
||||
|
||||
#[test]
|
||||
fn test_chain_spends() {
|
||||
let local_chain: LocalChain = (0..=100)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect::<BTreeMap<u32, BlockHash>>()
|
||||
.into();
|
||||
let tip = local_chain.tip().expect("must have tip");
|
||||
let local_chain = LocalChain::from_blocks(
|
||||
(0..=100)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect(),
|
||||
)
|
||||
.expect("must have genesis hash");
|
||||
let tip = local_chain.tip();
|
||||
|
||||
// The parent tx contains 2 outputs. Which are spent by one confirmed and one unconfirmed tx.
|
||||
// The parent tx is confirmed at block 95.
|
||||
@@ -906,18 +910,15 @@ fn test_chain_spends() {
|
||||
let _ = graph.insert_tx(tx_1.clone());
|
||||
let _ = graph.insert_tx(tx_2.clone());
|
||||
|
||||
[95, 98]
|
||||
.iter()
|
||||
.zip([&tx_0, &tx_1].into_iter())
|
||||
.for_each(|(ht, tx)| {
|
||||
let _ = graph.insert_anchor(
|
||||
tx.txid(),
|
||||
ConfirmationHeightAnchor {
|
||||
anchor_block: tip.block_id(),
|
||||
confirmation_height: *ht,
|
||||
},
|
||||
);
|
||||
});
|
||||
for (ht, tx) in [(95, &tx_0), (98, &tx_1)] {
|
||||
let _ = graph.insert_anchor(
|
||||
tx.txid(),
|
||||
ConfirmationHeightAnchor {
|
||||
anchor_block: tip.block_id(),
|
||||
confirmation_height: ht,
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
// Assert that confirmed spends are returned correctly.
|
||||
assert_eq!(
|
||||
@@ -1078,7 +1079,7 @@ fn test_missing_blocks() {
|
||||
g
|
||||
},
|
||||
chain: {
|
||||
let mut c = LocalChain::default();
|
||||
let (mut c, _) = LocalChain::from_genesis_hash(h!("genesis"));
|
||||
for (height, hash) in chain {
|
||||
let _ = c.insert_block(BlockId {
|
||||
height: *height,
|
||||
|
||||
@@ -39,21 +39,61 @@ fn test_tx_conflict_handling() {
|
||||
(5, h!("F")),
|
||||
(6, h!("G"))
|
||||
);
|
||||
let chain_tip = local_chain
|
||||
.tip()
|
||||
.map(|cp| cp.block_id())
|
||||
.unwrap_or_default();
|
||||
let chain_tip = local_chain.tip().block_id();
|
||||
|
||||
let scenarios = [
|
||||
Scenario {
|
||||
name: "coinbase tx cannot be in mempool and be unconfirmed",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "unconfirmed_coinbase",
|
||||
inputs: &[TxInTemplate::Coinbase],
|
||||
outputs: &[TxOutTemplate::new(5000, Some(0))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "confirmed_genesis",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(1))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "unconfirmed_conflict",
|
||||
inputs: &[
|
||||
TxInTemplate::PrevTx("confirmed_genesis", 0),
|
||||
TxInTemplate::PrevTx("unconfirmed_coinbase", 0)
|
||||
],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "confirmed_conflict",
|
||||
inputs: &[TxInTemplate::PrevTx("confirmed_genesis", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||
anchors: &[block_id!(4, "E")],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["confirmed_genesis", "confirmed_conflict"]),
|
||||
exp_chain_txouts: HashSet::from([("confirmed_genesis", 0), ("confirmed_conflict", 0)]),
|
||||
exp_unspents: HashSet::from([("confirmed_conflict", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 20000,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "2 unconfirmed txs with same last_seens conflict",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(40000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
@@ -70,14 +110,13 @@ fn test_tx_conflict_handling() {
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// correct output if filtered by fee rate: tx1, tx_conflict_1
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_1", "tx_conflict_2"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_1", 0), ("tx_conflict_2", 0)]),
|
||||
// correct output if filtered by fee rate: tx_conflict_1
|
||||
exp_unspents: HashSet::from([("tx_conflict_1", 0), ("tx_conflict_2", 0)]),
|
||||
// the txgraph is going to pick tx_conflict_2 because of higher lexicographical txid
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_2", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 50000, // correct output if filtered by fee rate: 20000
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
|
||||
@@ -2,7 +2,7 @@ use bdk_chain::{
|
||||
bitcoin::{OutPoint, ScriptBuf, Transaction, Txid},
|
||||
local_chain::{self, CheckPoint},
|
||||
tx_graph::{self, TxGraph},
|
||||
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeAnchor,
|
||||
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeHeightAnchor,
|
||||
};
|
||||
use electrum_client::{Client, ElectrumApi, Error, HeaderNotification};
|
||||
use std::{
|
||||
@@ -11,8 +11,8 @@ use std::{
|
||||
str::FromStr,
|
||||
};
|
||||
|
||||
/// We assume that a block of this depth and deeper cannot be reorged.
|
||||
const ASSUME_FINAL_DEPTH: u32 = 8;
|
||||
/// We include a chain suffix of a certain length for the purpose of robustness.
|
||||
const CHAIN_SUFFIX_LENGTH: u32 = 8;
|
||||
|
||||
/// Represents updates fetched from an Electrum server, but excludes full transactions.
|
||||
///
|
||||
@@ -57,7 +57,7 @@ impl RelevantTxids {
|
||||
}
|
||||
|
||||
/// Finalizes [`RelevantTxids`] with `new_txs` and anchors of type
|
||||
/// [`ConfirmationTimeAnchor`].
|
||||
/// [`ConfirmationTimeHeightAnchor`].
|
||||
///
|
||||
/// **Note:** The confirmation time might not be precisely correct if there has been a reorg.
|
||||
/// Electrum's API intends that we use the merkle proof API, we should change `bdk_electrum` to
|
||||
@@ -67,7 +67,7 @@ impl RelevantTxids {
|
||||
client: &Client,
|
||||
seen_at: Option<u64>,
|
||||
missing: Vec<Txid>,
|
||||
) -> Result<TxGraph<ConfirmationTimeAnchor>, Error> {
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
let graph = self.into_tx_graph(client, seen_at, missing)?;
|
||||
|
||||
let relevant_heights = {
|
||||
@@ -103,7 +103,7 @@ impl RelevantTxids {
|
||||
.map(|(height_anchor, txid)| {
|
||||
let confirmation_height = height_anchor.confirmation_height;
|
||||
let confirmation_time = height_to_time[&confirmation_height];
|
||||
let time_anchor = ConfirmationTimeAnchor {
|
||||
let time_anchor = ConfirmationTimeHeightAnchor {
|
||||
anchor_block: height_anchor.anchor_block,
|
||||
confirmation_height,
|
||||
confirmation_time,
|
||||
@@ -148,7 +148,7 @@ pub trait ElectrumExt {
|
||||
/// single batch request.
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
prev_tip: Option<CheckPoint>,
|
||||
prev_tip: CheckPoint,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
@@ -161,7 +161,7 @@ pub trait ElectrumExt {
|
||||
/// [`scan`]: ElectrumExt::scan
|
||||
fn scan_without_keychain(
|
||||
&self,
|
||||
prev_tip: Option<CheckPoint>,
|
||||
prev_tip: CheckPoint,
|
||||
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
@@ -188,7 +188,7 @@ pub trait ElectrumExt {
|
||||
impl ElectrumExt for Client {
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
prev_tip: Option<CheckPoint>,
|
||||
prev_tip: CheckPoint,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
@@ -289,25 +289,23 @@ impl ElectrumExt for Client {
|
||||
/// Return a [`CheckPoint`] of the latest tip, that connects with `prev_tip`.
|
||||
fn construct_update_tip(
|
||||
client: &Client,
|
||||
prev_tip: Option<CheckPoint>,
|
||||
prev_tip: CheckPoint,
|
||||
) -> Result<(CheckPoint, Option<u32>), Error> {
|
||||
let HeaderNotification { height, .. } = client.block_headers_subscribe()?;
|
||||
let new_tip_height = height as u32;
|
||||
|
||||
// If electrum returns a tip height that is lower than our previous tip, then checkpoints do
|
||||
// not need updating. We just return the previous tip and use that as the point of agreement.
|
||||
if let Some(prev_tip) = prev_tip.as_ref() {
|
||||
if new_tip_height < prev_tip.height() {
|
||||
return Ok((prev_tip.clone(), Some(prev_tip.height())));
|
||||
}
|
||||
if new_tip_height < prev_tip.height() {
|
||||
return Ok((prev_tip.clone(), Some(prev_tip.height())));
|
||||
}
|
||||
|
||||
// Atomically fetch the latest `ASSUME_FINAL_DEPTH` count of blocks from Electrum. We use this
|
||||
// Atomically fetch the latest `CHAIN_SUFFIX_LENGTH` count of blocks from Electrum. We use this
|
||||
// to construct our checkpoint update.
|
||||
let mut new_blocks = {
|
||||
let start_height = new_tip_height.saturating_sub(ASSUME_FINAL_DEPTH);
|
||||
let start_height = new_tip_height.saturating_sub(CHAIN_SUFFIX_LENGTH - 1);
|
||||
let hashes = client
|
||||
.block_headers(start_height as _, ASSUME_FINAL_DEPTH as _)?
|
||||
.block_headers(start_height as _, CHAIN_SUFFIX_LENGTH as _)?
|
||||
.headers
|
||||
.into_iter()
|
||||
.map(|h| h.block_hash());
|
||||
@@ -317,7 +315,7 @@ fn construct_update_tip(
|
||||
// Find the "point of agreement" (if any).
|
||||
let agreement_cp = {
|
||||
let mut agreement_cp = Option::<CheckPoint>::None;
|
||||
for cp in prev_tip.iter().flat_map(CheckPoint::iter) {
|
||||
for cp in prev_tip.iter() {
|
||||
let cp_block = cp.block_id();
|
||||
let hash = match new_blocks.get(&cp_block.height) {
|
||||
Some(&hash) => hash,
|
||||
|
||||
@@ -30,4 +30,5 @@ default = ["std", "async-https", "blocking"]
|
||||
std = ["bdk_chain/std"]
|
||||
async = ["async-trait", "futures", "esplora-client/async"]
|
||||
async-https = ["async", "esplora-client/async-https"]
|
||||
async-https-rustls = ["async", "esplora-client/async-https-rustls"]
|
||||
blocking = ["esplora-client/blocking"]
|
||||
|
||||
@@ -4,7 +4,7 @@ use bdk_chain::{
|
||||
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||
collections::{BTreeMap, BTreeSet},
|
||||
local_chain::{self, CheckPoint},
|
||||
BlockId, ConfirmationTimeAnchor, TxGraph,
|
||||
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||
};
|
||||
use esplora_client::{Error, TxStatus};
|
||||
use futures::{stream::FuturesOrdered, TryStreamExt};
|
||||
@@ -32,7 +32,7 @@ pub trait EsploraAsyncExt {
|
||||
#[allow(clippy::result_large_err)]
|
||||
async fn update_local_chain(
|
||||
&self,
|
||||
local_tip: Option<CheckPoint>,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||
) -> Result<local_chain::Update, Error>;
|
||||
|
||||
@@ -40,7 +40,7 @@ pub trait EsploraAsyncExt {
|
||||
/// indices.
|
||||
///
|
||||
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to include in the update
|
||||
///
|
||||
@@ -58,7 +58,7 @@ pub trait EsploraAsyncExt {
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<(TxGraph<ConfirmationTimeAnchor>, BTreeMap<K, u32>), Error>;
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||
|
||||
/// Convenience method to call [`scan_txs_with_keychains`] without requiring a keychain.
|
||||
///
|
||||
@@ -70,7 +70,7 @@ pub trait EsploraAsyncExt {
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
parallel_requests: usize,
|
||||
) -> Result<TxGraph<ConfirmationTimeAnchor>, Error> {
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
self.scan_txs_with_keychains(
|
||||
[(
|
||||
(),
|
||||
@@ -95,7 +95,7 @@ pub trait EsploraAsyncExt {
|
||||
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
async fn update_local_chain(
|
||||
&self,
|
||||
local_tip: Option<CheckPoint>,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||
) -> Result<local_chain::Update, Error> {
|
||||
let request_heights = request_heights.into_iter().collect::<BTreeSet<_>>();
|
||||
@@ -129,41 +129,39 @@ impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
let earliest_agreement_cp = {
|
||||
let mut earliest_agreement_cp = Option::<CheckPoint>::None;
|
||||
|
||||
if let Some(local_tip) = local_tip {
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height).await?
|
||||
},
|
||||
),
|
||||
};
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height).await?
|
||||
},
|
||||
),
|
||||
};
|
||||
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -211,10 +209,10 @@ impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<(TxGraph<ConfirmationTimeAnchor>, BTreeMap<K, u32>), Error> {
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
let mut graph = TxGraph::<ConfirmationTimeAnchor>::default();
|
||||
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
@@ -261,7 +259,13 @@ impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
}
|
||||
}
|
||||
|
||||
if last_index > last_active_index.map(|i| i.saturating_add(stop_gap as u32)) {
|
||||
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||
let past_gap_limit = if let Some(i) = last_active_index {
|
||||
last_index > i.saturating_add(stop_gap as u32)
|
||||
} else {
|
||||
last_index >= stop_gap as u32
|
||||
};
|
||||
if past_gap_limit {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -5,7 +5,7 @@ use bdk_chain::collections::{BTreeMap, BTreeSet};
|
||||
use bdk_chain::{
|
||||
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||
local_chain::{self, CheckPoint},
|
||||
BlockId, ConfirmationTimeAnchor, TxGraph,
|
||||
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||
};
|
||||
use esplora_client::{Error, TxStatus};
|
||||
|
||||
@@ -30,7 +30,7 @@ pub trait EsploraExt {
|
||||
#[allow(clippy::result_large_err)]
|
||||
fn update_local_chain(
|
||||
&self,
|
||||
local_tip: Option<CheckPoint>,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<Item = u32>,
|
||||
) -> Result<local_chain::Update, Error>;
|
||||
|
||||
@@ -38,7 +38,7 @@ pub trait EsploraExt {
|
||||
/// indices.
|
||||
///
|
||||
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to include in the update
|
||||
///
|
||||
@@ -53,7 +53,7 @@ pub trait EsploraExt {
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<(TxGraph<ConfirmationTimeAnchor>, BTreeMap<K, u32>), Error>;
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||
|
||||
/// Convenience method to call [`scan_txs_with_keychains`] without requiring a keychain.
|
||||
///
|
||||
@@ -65,7 +65,7 @@ pub trait EsploraExt {
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
parallel_requests: usize,
|
||||
) -> Result<TxGraph<ConfirmationTimeAnchor>, Error> {
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
self.scan_txs_with_keychains(
|
||||
[(
|
||||
(),
|
||||
@@ -87,7 +87,7 @@ pub trait EsploraExt {
|
||||
impl EsploraExt for esplora_client::BlockingClient {
|
||||
fn update_local_chain(
|
||||
&self,
|
||||
local_tip: Option<CheckPoint>,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<Item = u32>,
|
||||
) -> Result<local_chain::Update, Error> {
|
||||
let request_heights = request_heights.into_iter().collect::<BTreeSet<_>>();
|
||||
@@ -120,41 +120,39 @@ impl EsploraExt for esplora_client::BlockingClient {
|
||||
let earliest_agreement_cp = {
|
||||
let mut earliest_agreement_cp = Option::<CheckPoint>::None;
|
||||
|
||||
if let Some(local_tip) = local_tip {
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height)?
|
||||
},
|
||||
),
|
||||
};
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height)?
|
||||
},
|
||||
),
|
||||
};
|
||||
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -199,10 +197,10 @@ impl EsploraExt for esplora_client::BlockingClient {
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<(TxGraph<ConfirmationTimeAnchor>, BTreeMap<K, u32>), Error> {
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
let mut graph = TxGraph::<ConfirmationTimeAnchor>::default();
|
||||
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
@@ -252,7 +250,13 @@ impl EsploraExt for esplora_client::BlockingClient {
|
||||
}
|
||||
}
|
||||
|
||||
if last_index > last_active_index.map(|i| i.saturating_add(stop_gap as u32)) {
|
||||
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||
let past_gap_limit = if let Some(i) = last_active_index {
|
||||
last_index > i.saturating_add(stop_gap as u32)
|
||||
} else {
|
||||
last_index >= stop_gap as u32
|
||||
};
|
||||
if past_gap_limit {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
#![doc = include_str!("../README.md")]
|
||||
use bdk_chain::{BlockId, ConfirmationTimeAnchor};
|
||||
use bdk_chain::{BlockId, ConfirmationTimeHeightAnchor};
|
||||
use esplora_client::TxStatus;
|
||||
|
||||
pub use esplora_client;
|
||||
@@ -16,7 +16,7 @@ pub use async_ext::*;
|
||||
|
||||
const ASSUME_FINAL_DEPTH: u32 = 15;
|
||||
|
||||
fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeAnchor> {
|
||||
fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeHeightAnchor> {
|
||||
if let TxStatus {
|
||||
block_height: Some(height),
|
||||
block_hash: Some(hash),
|
||||
@@ -24,7 +24,7 @@ fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeAnchor> {
|
||||
..
|
||||
} = status.clone()
|
||||
{
|
||||
Some(ConfirmationTimeAnchor {
|
||||
Some(ConfirmationTimeHeightAnchor {
|
||||
anchor_block: BlockId { height, hash },
|
||||
confirmation_height: height,
|
||||
confirmation_time: time,
|
||||
|
||||
@@ -3,6 +3,7 @@ use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||
use electrsd::{Conf, ElectrsD};
|
||||
use esplora_client::{self, AsyncClient, Builder};
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
use std::str::FromStr;
|
||||
use std::thread::sleep;
|
||||
use std::time::Duration;
|
||||
@@ -115,3 +116,121 @@ pub async fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||
assert_eq!(graph_update_txids, expected_txids);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Test the bounds of the address scan depending on the gap limit.
|
||||
#[tokio::test]
|
||||
pub async fn test_async_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
|
||||
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||
let addresses = [
|
||||
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||
];
|
||||
let addresses: Vec<_> = addresses
|
||||
.into_iter()
|
||||
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||
.collect();
|
||||
let spks: Vec<_> = addresses
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||
.collect();
|
||||
let mut keychains = BTreeMap::new();
|
||||
keychains.insert(0, spks);
|
||||
|
||||
// Then receive coins on the 4th address.
|
||||
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[3],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().await.unwrap() < 103 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||
// will.
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
2,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
assert!(graph_update.full_txs().next().is_none());
|
||||
assert!(active_indices.is_empty());
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
3,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
|
||||
// Now receive a coin on the last address.
|
||||
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[addresses.len() - 1],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().await.unwrap() < 104 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||
// The last active indice won't be updated in the first case but will in the second one.
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
4,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 1);
|
||||
assert!(txs.contains(&txid_4th_addr));
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(keychains, vec![].into_iter(), vec![].into_iter(), 5, 1)
|
||||
.await?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 2);
|
||||
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||
assert_eq!(active_indices[&0], 9);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -3,6 +3,7 @@ use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||
use electrsd::{Conf, ElectrsD};
|
||||
use esplora_client::{self, BlockingClient, Builder};
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
use std::str::FromStr;
|
||||
use std::thread::sleep;
|
||||
use std::time::Duration;
|
||||
@@ -110,5 +111,118 @@ pub fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||
let mut expected_txids = vec![txid1, txid2];
|
||||
expected_txids.sort();
|
||||
assert_eq!(graph_update_txids, expected_txids);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Test the bounds of the address scan depending on the gap limit.
|
||||
#[test]
|
||||
pub fn test_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
|
||||
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||
let addresses = [
|
||||
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||
];
|
||||
let addresses: Vec<_> = addresses
|
||||
.into_iter()
|
||||
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||
.collect();
|
||||
let spks: Vec<_> = addresses
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||
.collect();
|
||||
let mut keychains = BTreeMap::new();
|
||||
keychains.insert(0, spks);
|
||||
|
||||
// Then receive coins on the 4th address.
|
||||
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[3],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().unwrap() < 103 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||
// will.
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
2,
|
||||
1,
|
||||
)?;
|
||||
assert!(graph_update.full_txs().next().is_none());
|
||||
assert!(active_indices.is_empty());
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
3,
|
||||
1,
|
||||
)?;
|
||||
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
|
||||
// Now receive a coin on the last address.
|
||||
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[addresses.len() - 1],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().unwrap() < 104 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||
// The last active indice won't be updated in the first case but will in the second one.
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
4,
|
||||
1,
|
||||
)?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 1);
|
||||
assert!(txs.contains(&txid_4th_addr));
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains,
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
5,
|
||||
1,
|
||||
)?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 2);
|
||||
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||
assert_eq!(active_indices[&0], 9);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -23,7 +23,7 @@ pub struct Store<'a, C> {
|
||||
|
||||
impl<'a, C> PersistBackend<C> for Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
type WriteError = std::io::Error;
|
||||
|
||||
@@ -33,30 +33,64 @@ where
|
||||
self.append_changeset(changeset)
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
let (changeset, result) = self.aggregate_changesets();
|
||||
result.map(|_| changeset)
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||
self.aggregate_changesets().map_err(|e| e.iter_error)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, C> Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
/// Creates a new store from a [`File`].
|
||||
/// Create a new [`Store`] file in write-only mode; error if the file exists.
|
||||
///
|
||||
/// The file must have been opened with read and write permissions.
|
||||
/// `magic` is the prefixed bytes to write to the new file. This will be checked when opening
|
||||
/// the `Store` in the future with [`open`].
|
||||
///
|
||||
/// `magic` is the expected prefixed bytes of the file. If this does not match, an error will be
|
||||
/// returned.
|
||||
/// [`open`]: Store::open
|
||||
pub fn create_new<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
if file_path.as_ref().exists() {
|
||||
// `io::Error` is used instead of a variant on `FileError` because there is already a
|
||||
// nightly-only `File::create_new` method
|
||||
return Err(FileError::Io(io::Error::new(
|
||||
io::ErrorKind::Other,
|
||||
"file already exists",
|
||||
)));
|
||||
}
|
||||
let mut f = OpenOptions::new()
|
||||
.create(true)
|
||||
.read(true)
|
||||
.write(true)
|
||||
.open(file_path)?;
|
||||
f.write_all(magic)?;
|
||||
Ok(Self {
|
||||
magic,
|
||||
db_file: f,
|
||||
marker: Default::default(),
|
||||
})
|
||||
}
|
||||
|
||||
/// Open an existing [`Store`].
|
||||
///
|
||||
/// [`File`]: std::fs::File
|
||||
pub fn new(magic: &'a [u8], mut db_file: File) -> Result<Self, FileError> {
|
||||
db_file.rewind()?;
|
||||
/// Use [`create_new`] to create a new `Store`.
|
||||
///
|
||||
/// # Errors
|
||||
///
|
||||
/// If the prefixed bytes of the opened file does not match the provided `magic`, the
|
||||
/// [`FileError::InvalidMagicBytes`] error variant will be returned.
|
||||
///
|
||||
/// [`create_new`]: Store::create_new
|
||||
pub fn open<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
let mut f = OpenOptions::new().read(true).write(true).open(file_path)?;
|
||||
|
||||
let mut magic_buf = vec![0_u8; magic.len()];
|
||||
db_file.read_exact(magic_buf.as_mut())?;
|
||||
|
||||
f.read_exact(&mut magic_buf)?;
|
||||
if magic_buf != magic {
|
||||
return Err(FileError::InvalidMagicBytes {
|
||||
got: magic_buf,
|
||||
@@ -66,35 +100,26 @@ where
|
||||
|
||||
Ok(Self {
|
||||
magic,
|
||||
db_file,
|
||||
db_file: f,
|
||||
marker: Default::default(),
|
||||
})
|
||||
}
|
||||
|
||||
/// Creates or loads a store from `db_path`.
|
||||
/// Attempt to open existing [`Store`] file; create it if the file is non-existant.
|
||||
///
|
||||
/// If no file exists there, it will be created.
|
||||
/// Internally, this calls either [`open`] or [`create_new`].
|
||||
///
|
||||
/// Refer to [`new`] for documentation on the `magic` input.
|
||||
///
|
||||
/// [`new`]: Self::new
|
||||
pub fn new_from_path<P>(magic: &'a [u8], db_path: P) -> Result<Self, FileError>
|
||||
/// [`open`]: Store::open
|
||||
/// [`create_new`]: Store::create_new
|
||||
pub fn open_or_create_new<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
let already_exists = db_path.as_ref().exists();
|
||||
|
||||
let mut db_file = OpenOptions::new()
|
||||
.read(true)
|
||||
.write(true)
|
||||
.create(true)
|
||||
.open(db_path)?;
|
||||
|
||||
if !already_exists {
|
||||
db_file.write_all(magic)?;
|
||||
if file_path.as_ref().exists() {
|
||||
Self::open(magic, file_path)
|
||||
} else {
|
||||
Self::create_new(magic, file_path)
|
||||
}
|
||||
|
||||
Self::new(magic, db_file)
|
||||
}
|
||||
|
||||
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
||||
@@ -122,16 +147,24 @@ where
|
||||
///
|
||||
/// **WARNING**: This method changes the write position of the underlying file. The next
|
||||
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
||||
pub fn aggregate_changesets(&mut self) -> (C, Result<(), IterError>) {
|
||||
let mut changeset = C::default();
|
||||
let result = (|| {
|
||||
for next_changeset in self.iter_changesets() {
|
||||
changeset.append(next_changeset?);
|
||||
pub fn aggregate_changesets(&mut self) -> Result<Option<C>, AggregateChangesetsError<C>> {
|
||||
let mut changeset = Option::<C>::None;
|
||||
for next_changeset in self.iter_changesets() {
|
||||
let next_changeset = match next_changeset {
|
||||
Ok(next_changeset) => next_changeset,
|
||||
Err(iter_error) => {
|
||||
return Err(AggregateChangesetsError {
|
||||
changeset,
|
||||
iter_error,
|
||||
})
|
||||
}
|
||||
};
|
||||
match &mut changeset {
|
||||
Some(changeset) => changeset.append(next_changeset),
|
||||
changeset => *changeset = Some(next_changeset),
|
||||
}
|
||||
Ok(())
|
||||
})();
|
||||
|
||||
(changeset, result)
|
||||
}
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Append a new changeset to the file and truncate the file to the end of the appended
|
||||
@@ -162,6 +195,24 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// Error type for [`Store::aggregate_changesets`].
|
||||
#[derive(Debug)]
|
||||
pub struct AggregateChangesetsError<C> {
|
||||
/// The partially-aggregated changeset.
|
||||
pub changeset: Option<C>,
|
||||
|
||||
/// The error returned by [`EntryIter`].
|
||||
pub iter_error: IterError,
|
||||
}
|
||||
|
||||
impl<C> std::fmt::Display for AggregateChangesetsError<C> {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
std::fmt::Display::fmt(&self.iter_error, f)
|
||||
}
|
||||
}
|
||||
|
||||
impl<C: std::fmt::Debug> std::error::Error for AggregateChangesetsError<C> {}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use super::*;
|
||||
@@ -182,13 +233,50 @@ mod test {
|
||||
#[derive(Debug)]
|
||||
struct TestTracker;
|
||||
|
||||
/// Check behavior of [`Store::create_new`] and [`Store::open`].
|
||||
#[test]
|
||||
fn construct_store() {
|
||||
let temp_dir = tempfile::tempdir().unwrap();
|
||||
let file_path = temp_dir.path().join("db_file");
|
||||
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect_err("must not open as file does not exist yet");
|
||||
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must create file");
|
||||
// cannot create new as file already exists
|
||||
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect_err("must fail as file already exists now");
|
||||
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must open as file exists now");
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn open_or_create_new() {
|
||||
let temp_dir = tempfile::tempdir().unwrap();
|
||||
let file_path = temp_dir.path().join("db_file");
|
||||
let changeset = vec!["hello".to_string(), "world".to_string()];
|
||||
|
||||
{
|
||||
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must create");
|
||||
assert!(file_path.exists());
|
||||
db.append_changeset(&changeset).expect("must succeed");
|
||||
}
|
||||
|
||||
{
|
||||
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must recover");
|
||||
let recovered_changeset = db.aggregate_changesets().expect("must succeed");
|
||||
assert_eq!(recovered_changeset, Some(changeset));
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn new_fails_if_file_is_too_short() {
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&TEST_MAGIC_BYTES[..TEST_MAGIC_BYTES_LEN - 1])
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||
};
|
||||
@@ -202,7 +290,7 @@ mod test {
|
||||
file.write_all(invalid_magic_bytes.as_bytes())
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||
Err(FileError::InvalidMagicBytes { got, .. }) => {
|
||||
assert_eq!(got, invalid_magic_bytes.as_bytes())
|
||||
}
|
||||
@@ -221,8 +309,8 @@ mod test {
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&data).expect("should write");
|
||||
|
||||
let mut store = Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap())
|
||||
.expect("should open");
|
||||
let mut store =
|
||||
Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()).expect("should open");
|
||||
match store.iter_changesets().next() {
|
||||
Some(Err(IterError::Bincode(_))) => {}
|
||||
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
|
||||
@@ -15,7 +15,7 @@ use bdk_chain::{
|
||||
bitcoin::{Block, Transaction},
|
||||
indexed_tx_graph, keychain,
|
||||
local_chain::{self, CheckPoint, LocalChain},
|
||||
ConfirmationTimeAnchor, IndexedTxGraph,
|
||||
ConfirmationTimeHeightAnchor, IndexedTxGraph,
|
||||
};
|
||||
use example_cli::{
|
||||
anyhow,
|
||||
@@ -32,12 +32,12 @@ const CHANNEL_BOUND: usize = 10;
|
||||
const STDOUT_PRINT_DELAY: Duration = Duration::from_secs(6);
|
||||
/// Delay between mempool emissions.
|
||||
const MEMPOOL_EMIT_DELAY: Duration = Duration::from_secs(30);
|
||||
/// Delay for committing to persistance.
|
||||
/// Delay for committing to persistence.
|
||||
const DB_COMMIT_DELAY: Duration = Duration::from_secs(60);
|
||||
|
||||
type ChangeSet = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeAnchor, keychain::ChangeSet<Keychain>>,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
|
||||
#[derive(Debug)]
|
||||
@@ -131,7 +131,7 @@ fn main() -> anyhow::Result<()> {
|
||||
start.elapsed().as_secs_f32()
|
||||
);
|
||||
|
||||
let chain = Mutex::new(LocalChain::from_changeset(init_changeset.0));
|
||||
let chain = Mutex::new(LocalChain::from_changeset(init_changeset.0)?);
|
||||
println!(
|
||||
"[{:>10}s] loaded local chain from changeset",
|
||||
start.elapsed().as_secs_f32()
|
||||
@@ -170,10 +170,7 @@ fn main() -> anyhow::Result<()> {
|
||||
|
||||
let chain_tip = chain.lock().unwrap().tip();
|
||||
let rpc_client = rpc_args.new_client()?;
|
||||
let mut emitter = match chain_tip {
|
||||
Some(cp) => Emitter::from_checkpoint(&rpc_client, cp),
|
||||
None => Emitter::from_height(&rpc_client, fallback_height),
|
||||
};
|
||||
let mut emitter = Emitter::new(&rpc_client, chain_tip, fallback_height);
|
||||
|
||||
let mut last_db_commit = Instant::now();
|
||||
let mut last_print = Instant::now();
|
||||
@@ -187,7 +184,7 @@ fn main() -> anyhow::Result<()> {
|
||||
CheckPoint::from_header(&block.header, height).into_update(false);
|
||||
let chain_changeset = chain
|
||||
.apply_update(chain_update)
|
||||
.expect("must always apply as we recieve blocks in order from emitter");
|
||||
.expect("must always apply as we receive blocks in order from emitter");
|
||||
let graph_changeset = graph.apply_block_relevant(block, height);
|
||||
db.stage((chain_changeset, graph_changeset));
|
||||
|
||||
@@ -196,7 +193,7 @@ fn main() -> anyhow::Result<()> {
|
||||
last_db_commit = Instant::now();
|
||||
db.commit()?;
|
||||
println!(
|
||||
"[{:>10}s] commited to db (took {}s)",
|
||||
"[{:>10}s] committed to db (took {}s)",
|
||||
start.elapsed().as_secs_f32(),
|
||||
last_db_commit.elapsed().as_secs_f32()
|
||||
);
|
||||
@@ -205,23 +202,22 @@ fn main() -> anyhow::Result<()> {
|
||||
// print synced-to height and current balance in intervals
|
||||
if last_print.elapsed() >= STDOUT_PRINT_DELAY {
|
||||
last_print = Instant::now();
|
||||
if let Some(synced_to) = chain.tip() {
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
let synced_to = chain.tip();
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -253,10 +249,7 @@ fn main() -> anyhow::Result<()> {
|
||||
let (tx, rx) = std::sync::mpsc::sync_channel::<Emission>(CHANNEL_BOUND);
|
||||
let emission_jh = std::thread::spawn(move || -> anyhow::Result<()> {
|
||||
let rpc_client = rpc_args.new_client()?;
|
||||
let mut emitter = match last_cp {
|
||||
Some(cp) => Emitter::from_checkpoint(&rpc_client, cp),
|
||||
None => Emitter::from_height(&rpc_client, fallback_height),
|
||||
};
|
||||
let mut emitter = Emitter::new(&rpc_client, last_cp, fallback_height);
|
||||
|
||||
let mut block_count = rpc_client.get_block_count()? as u32;
|
||||
tx.send(Emission::Tip(block_count))?;
|
||||
@@ -305,7 +298,7 @@ fn main() -> anyhow::Result<()> {
|
||||
CheckPoint::from_header(&block.header, height).into_update(false);
|
||||
let chain_changeset = chain
|
||||
.apply_update(chain_update)
|
||||
.expect("must always apply as we recieve blocks in order from emitter");
|
||||
.expect("must always apply as we receive blocks in order from emitter");
|
||||
let graph_changeset = graph.apply_block_relevant(block, height);
|
||||
(chain_changeset, graph_changeset)
|
||||
}
|
||||
@@ -327,7 +320,7 @@ fn main() -> anyhow::Result<()> {
|
||||
last_db_commit = Instant::now();
|
||||
db.commit()?;
|
||||
println!(
|
||||
"[{:>10}s] commited to db (took {}s)",
|
||||
"[{:>10}s] committed to db (took {}s)",
|
||||
start.elapsed().as_secs_f32(),
|
||||
last_db_commit.elapsed().as_secs_f32()
|
||||
);
|
||||
@@ -335,24 +328,23 @@ fn main() -> anyhow::Result<()> {
|
||||
|
||||
if last_print.map_or(Duration::MAX, |i| i.elapsed()) >= STDOUT_PRINT_DELAY {
|
||||
last_print = Some(Instant::now());
|
||||
if let Some(synced_to) = chain.tip() {
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} / {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
tip_height,
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
let synced_to = chain.tip();
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} / {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
tip_height,
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -78,7 +78,7 @@ pub enum Commands<CS: clap::Subcommand, S: clap::Args> {
|
||||
#[clap(short, default_value = "bnb")]
|
||||
coin_select: CoinSelectionAlgo,
|
||||
#[clap(flatten)]
|
||||
chain_specfic: S,
|
||||
chain_specific: S,
|
||||
},
|
||||
}
|
||||
|
||||
@@ -315,10 +315,8 @@ where
|
||||
version: 0x02,
|
||||
// because the temporary planning module does not support timelocks, we can use the chain
|
||||
// tip as the `lock_time` for anti-fee-sniping purposes
|
||||
lock_time: chain
|
||||
.get_chain_tip()?
|
||||
.and_then(|block_id| absolute::LockTime::from_height(block_id.height).ok())
|
||||
.unwrap_or(absolute::LockTime::ZERO),
|
||||
lock_time: absolute::LockTime::from_height(chain.get_chain_tip()?.height)
|
||||
.expect("invalid height"),
|
||||
input: selected_txos
|
||||
.iter()
|
||||
.map(|(_, utxo)| TxIn {
|
||||
@@ -404,7 +402,7 @@ pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDeri
|
||||
chain: &O,
|
||||
assets: &bdk_tmp_plan::Assets<K>,
|
||||
) -> Result<Vec<(bdk_tmp_plan::Plan<K>, FullTxOut<A>)>, O::Error> {
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let chain_tip = chain.get_chain_tip()?;
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
graph
|
||||
.graph()
|
||||
@@ -509,7 +507,7 @@ where
|
||||
|
||||
let balance = graph.graph().try_balance(
|
||||
chain,
|
||||
chain.get_chain_tip()?.unwrap_or_default(),
|
||||
chain.get_chain_tip()?,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)?;
|
||||
@@ -539,7 +537,7 @@ where
|
||||
Commands::TxOut { txout_cmd } => {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let chain_tip = chain.get_chain_tip()?;
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
|
||||
match txout_cmd {
|
||||
@@ -587,7 +585,7 @@ where
|
||||
value,
|
||||
address,
|
||||
coin_select,
|
||||
chain_specfic,
|
||||
chain_specific,
|
||||
} => {
|
||||
let chain = &*chain.lock().unwrap();
|
||||
let address = address.require_network(network)?;
|
||||
@@ -620,7 +618,7 @@ where
|
||||
}
|
||||
};
|
||||
|
||||
match (broadcast)(chain_specfic, &transaction) {
|
||||
match (broadcast)(chain_specific, &transaction) {
|
||||
Ok(_) => {
|
||||
println!("Broadcasted Tx : {}", transaction.txid());
|
||||
|
||||
@@ -683,13 +681,13 @@ where
|
||||
index.add_keychain(Keychain::Internal, internal_descriptor);
|
||||
}
|
||||
|
||||
let mut db_backend = match Store::<'m, C>::new_from_path(db_magic, &args.db_path) {
|
||||
let mut db_backend = match Store::<'m, C>::open_or_create_new(db_magic, &args.db_path) {
|
||||
Ok(db_backend) => db_backend,
|
||||
// we cannot return `err` directly as it has lifetime `'m`
|
||||
Err(err) => return Err(anyhow::anyhow!("failed to init db backend: {:?}", err)),
|
||||
};
|
||||
|
||||
let init_changeset = db_backend.load_from_persistence()?;
|
||||
let init_changeset = db_backend.load_from_persistence()?.unwrap_or_default();
|
||||
|
||||
Ok((
|
||||
args,
|
||||
|
||||
@@ -112,7 +112,7 @@ fn main() -> anyhow::Result<()> {
|
||||
graph
|
||||
});
|
||||
|
||||
let chain = Mutex::new(LocalChain::from_changeset(disk_local_chain));
|
||||
let chain = Mutex::new(LocalChain::from_changeset(disk_local_chain)?);
|
||||
|
||||
let electrum_cmd = match &args.command {
|
||||
example_cli::Commands::ChainSpecific(electrum_cmd) => electrum_cmd,
|
||||
@@ -193,7 +193,7 @@ fn main() -> anyhow::Result<()> {
|
||||
// Get a short lock on the tracker to get the spks we're interested in
|
||||
let graph = graph.lock().unwrap();
|
||||
let chain = chain.lock().unwrap();
|
||||
let chain_tip = chain.tip().map(|cp| cp.block_id()).unwrap_or_default();
|
||||
let chain_tip = chain.tip().block_id();
|
||||
|
||||
if !(all_spks || unused_spks || utxos || unconfirmed) {
|
||||
unused_spks = true;
|
||||
|
||||
@@ -5,11 +5,11 @@ use std::{
|
||||
};
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{Address, Network, OutPoint, ScriptBuf, Txid},
|
||||
bitcoin::{constants::genesis_block, Address, Network, OutPoint, ScriptBuf, Txid},
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
keychain,
|
||||
local_chain::{self, CheckPoint, LocalChain},
|
||||
Append, ConfirmationTimeAnchor,
|
||||
local_chain::{self, LocalChain},
|
||||
Append, ConfirmationTimeHeightAnchor,
|
||||
};
|
||||
|
||||
use bdk_esplora::{esplora_client, EsploraExt};
|
||||
@@ -25,7 +25,7 @@ const DB_PATH: &str = ".bdk_esplora_example.db";
|
||||
|
||||
type ChangeSet = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeAnchor, keychain::ChangeSet<Keychain>>,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
@@ -102,9 +102,11 @@ fn main() -> anyhow::Result<()> {
|
||||
let (args, keymap, index, db, init_changeset) =
|
||||
example_cli::init::<EsploraCommands, EsploraArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
|
||||
let genesis_hash = genesis_block(args.network).block_hash();
|
||||
|
||||
let (init_chain_changeset, init_indexed_tx_graph_changeset) = init_changeset;
|
||||
|
||||
// Contruct `IndexedTxGraph` and `LocalChain` with our initial changeset. They are wrapped in
|
||||
// Construct `IndexedTxGraph` and `LocalChain` with our initial changeset. They are wrapped in
|
||||
// `Mutex` to display how they can be used in a multithreaded context. Technically the mutexes
|
||||
// aren't strictly needed here.
|
||||
let graph = Mutex::new({
|
||||
@@ -113,8 +115,8 @@ fn main() -> anyhow::Result<()> {
|
||||
graph
|
||||
});
|
||||
let chain = Mutex::new({
|
||||
let mut chain = LocalChain::default();
|
||||
chain.apply_changeset(&init_chain_changeset);
|
||||
let (mut chain, _) = LocalChain::from_genesis_hash(genesis_hash);
|
||||
chain.apply_changeset(&init_chain_changeset)?;
|
||||
chain
|
||||
});
|
||||
|
||||
@@ -234,7 +236,7 @@ fn main() -> anyhow::Result<()> {
|
||||
{
|
||||
let graph = graph.lock().unwrap();
|
||||
let chain = chain.lock().unwrap();
|
||||
let chain_tip = chain.tip().map(|cp| cp.block_id()).unwrap_or_default();
|
||||
let chain_tip = chain.tip().block_id();
|
||||
|
||||
if *all_spks {
|
||||
let all_spks = graph
|
||||
@@ -332,7 +334,7 @@ fn main() -> anyhow::Result<()> {
|
||||
(missing_block_heights, tip)
|
||||
};
|
||||
|
||||
println!("prev tip: {}", tip.as_ref().map_or(0, CheckPoint::height));
|
||||
println!("prev tip: {}", tip.height());
|
||||
println!("missing block heights: {:?}", missing_block_heights);
|
||||
|
||||
// Here, we actually fetch the missing blocks and create a `local_chain::Update`.
|
||||
|
||||
@@ -7,3 +7,4 @@ edition = "2021"
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_electrum = { path = "../../crates/electrum" }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
anyhow = "1"
|
||||
|
||||
@@ -16,20 +16,20 @@ use bdk_electrum::{
|
||||
};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-electrum-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(bdk::wallet::AddressIndex::New);
|
||||
let address = wallet.try_get_address(bdk::wallet::AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
|
||||
@@ -10,3 +10,4 @@ bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["async-https"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||
anyhow = "1"
|
||||
|
||||
@@ -14,20 +14,20 @@ const STOP_GAP: usize = 50;
|
||||
const PARALLEL_REQUESTS: usize = 5;
|
||||
|
||||
#[tokio::main]
|
||||
async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
async fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-async-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
|
||||
@@ -10,3 +10,4 @@ publish = false
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
anyhow = "1"
|
||||
|
||||
@@ -13,20 +13,20 @@ use bdk::{
|
||||
use bdk_esplora::{esplora_client, EsploraExt};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
|
||||
@@ -315,7 +315,7 @@ where
|
||||
self.set_sequence.clone()
|
||||
}
|
||||
|
||||
/// The minmum required transaction version required on the transaction using the plan.
|
||||
/// The minimum required transaction version required on the transaction using the plan.
|
||||
pub fn min_version(&self) -> Option<u32> {
|
||||
if let Some(_) = self.set_sequence {
|
||||
Some(2)
|
||||
|
||||
Reference in New Issue
Block a user